|
|
| | (1S,2R)-(-)-cis-1-Amino-2-indanol Basic information | | Reaction |
| Product Name: | (1S,2R)-(-)-cis-1-Amino-2-indanol | | Synonyms: | 5R)-LGH447 dihydrochloride;(1S,2R)-(-)-cis-1-Amino-2-hydroxyindane 126456-43-7 (1S,2R)-(-)-cis-1-Amino-2-indanol;(1S,2R)-(-)-cis-1-Amino-2-indanol 126456-43-7;(1S,2R)-(-)-cis-1-Amino-2-indanol,99%;(1S, 2R)-Trans-1-AMino-2-indanol;(1S,2R)-(-)-1-Amino-2,3-dihydro-1H-inden-2-ol, (1S,2R)-(-)-1-Aminoindan-2-ol;(1S,2R)-1-Amino-2,3-dihydro-inden-2-ol;(1S,2R)-(-)-cis-1-Amino-2-indanol ,98% | | CAS: | 126456-43-7 | | MF: | C9H11NO | | MW: | 149.19 | | EINECS: | | | Product Categories: | Chiral Nitrogen;organic alcohol;Amino Alcohols (Chiral);Chiral Building Blocks;Synthetic Organic Chemistry;CHIRAL CHEMICALS;Indinavir Sulfate;API intermediates;chiral;CHIRAL COMPOUNDS;OLED | | Mol File: | 126456-43-7.mol |  |
| | (1S,2R)-(-)-cis-1-Amino-2-indanol Chemical Properties |
| Melting point | 118-121 °C(lit.) | | alpha | -62 º (c=0.5, CHCl3) | | Boiling point | 270.27°C (rough estimate) | | density | 1.0753 (rough estimate) | | refractive index | 1.5760 (estimate) | | RTECS | NK7525500 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | soluble in Methanol | | pka | 14.79±0.40(Predicted) | | form | Powder | | color | White to light beige | | Optical Rotation | [α]20/D 61°, c = 0.5 in chloroform | | Water Solubility | slightly soluble | | Sensitive | Air Sensitive | | BRN | 4292559 | | InChI | 1S/C9H11NO/c10-9-7-4-2-1-3-6(7)5-8(9)11/h1-4,8-9,11H,5,10H2/t8-,9+/m1/s1 | | InChIKey | LOPKSXMQWBYUOI-BDAKNGLRSA-N | | SMILES | N[C@@H]1[C@H](O)Cc2ccccc12 | | CAS DataBase Reference | 126456-43-7(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-36-36/37/39 | | RIDADR | 3259 | | WGK Germany | 3 | | F | 10-23 | | TSCA | No | | HazardClass | 8 | | HS Code | 29052900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (1S,2R)-(-)-cis-1-Amino-2-indanol Usage And Synthesis |
| Reaction |
- Ligand component used in the chromium-catalyzed highly selective asymmetric ene reactions between aryl aldehydes and alkoxy- and silyloxyalkenes.
- Ligand component for the chromium-catalyzed highly enantioselective o inverse-demand hetero-Diels-Alder reactions of α,β-unsaturated aldehydes.
- Ligand component for the magnesium-catalyzed conjugate addition reaction of 1,3-dicarbonyl compounds to nitroalkenes.
- Component for stereoselective asymmetric 6π-azaelectrocyclization through the reaction between the (E)-3-
- carbonyl-2,4,6-trienal compounds and the (-)-7-alkyl-cis-1-amino-2-indanol derivatives.
- Ligand component for palladium-catalzyed asymmetric azaelectrocyclization for the preparation of 2,4-
- disubstituted chiral 1,2,5,6-tetrahydropyridines.
- Component for organocatalytic conjugate addition of formaldehyde N,N-dialkylhydrazones to β,γ -Unsaturated α-keto esters.
- N-Sulfinyl urea organocatalyst component for enantioselective aza-henry reaction.
- Component for organocatalytic enantioselective additions of indoles to nitroalkenes.



| | Chemical Properties | white to light yellow crystal powder | | Uses | 1S,2R)-(-)-cis-1-Amino-2-indanol may be used to prepare:
- (-)-1,2,5,6-Tetrahydropyridine by reacting with methyl (E,E)-4-oxo-2-[(2,6,6-trimethylcyclohex-1-enyl)vinyl}but-2-enoate.
- Oxazaborolidine catalysts, which can catalyze the asymmetric reduction of aromatic ketones with high enantioselectivity.
- (RS,1S,2R)-(-)-2,4,6-Trimethylbenzenesulfinic acid 1-(2,4,6-trimethylbenzenesulfonylamino)indan-2-yl ester.
| | Uses | (1S,2R)-(-)-cis-1-Amino-2-indanol is used as a reagent in the synthesis of heterocyclic compounds as integrase inhibiting antiviral agents. It is also a key intermediate of the HIV protease inhibitor, Indinavir (I525000). | | General Description | (1S,2R)-(-)-cis-1-Amino-2-indanol is a main constituent of indinavir, a potent HIV (human immunodeficiency virus) protease inhibitor. |
| | (1S,2R)-(-)-cis-1-Amino-2-indanol Preparation Products And Raw materials |
|