| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
PARA-TOPOLIN RIBOSIDE 99% (HPLC) manufacturers
|
| | PARA-TOPOLIN RIBOSIDE 99% (HPLC) Basic information |
| Product Name: | PARA-TOPOLIN RIBOSIDE 99% (HPLC) | | Synonyms: | PARA-TOPOLIN RIBOSIDE;PARA-TOPOLIN RIBOSIDE 99% (HPLC);N-[(4-Hydroxyphenyl)methyl]adenosine;N6-(4-Hydroxybenzyl)adenosine;(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[(4-hydroxyphenyl)methylamino]purin-9-yl]oxolane-3,4-diol;Adenosine, N-[(4-hydroxyphenyl)methyl]-;N6-(4-Hydroxybenzyl) adenine riboside >=98% (HPLC);NHBA (T1-11) | | CAS: | 110505-75-4 | | MF: | C17H19N5O5 | | MW: | 373.36 | | EINECS: | | | Product Categories: | | | Mol File: | 110505-75-4.mol |  |
| | PARA-TOPOLIN RIBOSIDE 99% (HPLC) Chemical Properties |
| Melting point | 201-204 °C(Solv: methanol (67-56-1); chloroform (67-66-3)) | | Boiling point | 753.2±70.0 °C(Predicted) | | density | 1.71 | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) | | pka | 9.72±0.15(Predicted) | | form | Solid | | color | White to Off-White | | InChIKey | UGVIXKXYLBAZND-LSCFUAHRSA-N | | SMILES | OC[C@H]1O[C@@H](N2C=NC3=C2N=CN=C3NCC4=CC=C(O)C=C4)[C@H](O)[C@@H]1O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | PARA-TOPOLIN RIBOSIDE 99% (HPLC) Usage And Synthesis |
| Uses | N6-(4-Hydroxybenzyl)adenosine is am endogenous compound extracted from G. elata for research interest for its potential sedative and hypnotic activity, as well as a neuroprotective and therapeutic agent for preventing and treating neurodegenerative disease. | | Biological Activity | N6-(4-Hydroxybenzyl) adenine riboside (NHBA) is an orally available and brain penetrant active active ingredient of Gastrodia elata rhizomes used for the treatment of insomnia. N6-(4-Hydroxybenzyl) adenine riboside is an adenosine A2A receptor and the equilibrative nucleoside transporter 1 (ENT1) agonist. It exhibits sedative and hypnotic effects by binding to adenosine A1 and A2A receptors in mice. N6-(4-Hydroxybenzyl) adenine riboside exerted a therapeutic effect on HD transgenic mouse by decreasing protein level of polyglutamine-expanded huntingtin in the striatum. |
| | PARA-TOPOLIN RIBOSIDE 99% (HPLC) Preparation Products And Raw materials |
|