|
|
| | Ethyl 3-oxo-4-(triphenylphosphoranylidene)butyrate Basic information |
| Product Name: | Ethyl 3-oxo-4-(triphenylphosphoranylidene)butyrate | | Synonyms: | [3-(Ethoxycarbonyl)-2-oxopropylidene]triphenylphosphorane, 98 %;[3-(ETHOXYCARBONYL)-2-OXOPROPYLIDENE]TRIPHENYLPHOSPHORANE;Ethyl 3-oxo-4-(triphenylphosphoranylidene)butanoate;Ethyl 3-oxo-4-(triphenylphosphoranylidene)butyrate, [3-(Ethoxycarbonyl)-2-oxopropylidene]triphenylphosphorane;3-Oxo-4-(triphenylphosphoranylidene)butanoic Acid Ethyl Ester;4-(Triphenylphosphoranylidene)acetoacetic Acid Ethyl Ester;Ethyl 3-oxo-4-(triphenylphosphoranylidene)butyrate,97%;Butanoic acid, 3-oxo-4-(triphenylphosphoranylidene)-, ethyl ester | | CAS: | 13148-05-5 | | MF: | C24H23O3P | | MW: | 390.41 | | EINECS: | | | Product Categories: | Wittig Reagents;Miscellaneous Reagents;C-C Bond Formation;Olefination | | Mol File: | 13148-05-5.mol |  |
| | Ethyl 3-oxo-4-(triphenylphosphoranylidene)butyrate Chemical Properties |
| Melting point | 101-106 °C | | Boiling point | 544.0±52.0 °C(Predicted) | | density | 1.18±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Acetone, Dichloromethane, Methanol | | form | solid | | color | Off-White to Pale Yellow | | Stability: | Moisture Sensitive | | InChI | 1S/C24H23O3P/c1-2-27-24(26)18-20(25)19-28(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-17,19H,2,18H2,1H3 | | InChIKey | QYXSFVCJCUXGJH-UHFFFAOYSA-N | | SMILES | CCOC(=O)CC(=O)C=P(c1ccccc1)(c2ccccc2)c3ccccc3 |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids |
| | Ethyl 3-oxo-4-(triphenylphosphoranylidene)butyrate Usage And Synthesis |
| Description | Ethyl 3-oxo-4-(triphenylphosphoranylidene)butyrate is a Wittig reagent for the stereoselective synthesis of (Z)-enones; annulation reagent for the synthesis of
cyclohexenones. | | Chemical Properties | Off-White Powder | | Uses | Ethyl 3-oxo-4-(triphenylphosphoranylidene)butyrate can be a useful synthetic intermediate in the production of antibiotics. | | Uses | Can be coupled with glyoxals in a one-step route to 4-hydroxycyclopentanones. Also used to prepare 2H-pyran-2-ones from oxazolones. | | reaction suitability | reaction type: C-C Bond Formation | | Synthesis | Ethyl 4- (Triphenylphosphoranylidene)acetoacetate is prepared in two steps from ethyl or
methyl 4-chloroacetoacetates (see Ethyl 4-Chloroacetoacetate), respectively, in 58-68% overall yield (eq 1).
 |
| | Ethyl 3-oxo-4-(triphenylphosphoranylidene)butyrate Preparation Products And Raw materials |
|