| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (3-Ethoxycarbonyl-2-oxopropyl)triphenylphosphonium chloride Basic information |
| | (3-Ethoxycarbonyl-2-oxopropyl)triphenylphosphonium chloride Chemical Properties |
| Melting point | 160 °C (dec.)(lit.) | | InChI | 1S/C24H24O3P.ClH/c1-2-27-24(26)18-20(25)19-28(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23;/h3-17H,2,18-19H2,1H3;1H/q+1;/p-1 | | InChIKey | BRRCLIKFZISBBV-UHFFFAOYSA-M | | SMILES | [Cl-].CCOC(=O)CC(=O)C[P+](c1ccccc1)(c2ccccc2)c3ccccc3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (3-Ethoxycarbonyl-2-oxopropyl)triphenylphosphonium chloride Usage And Synthesis |
| Uses | Reactant for:
- Preparation of cyclic amidine-based inhibitors of -secretase (BACE-1)
- Wittig reactions
- Dehydrochlorination and alkylation reactions
| | reaction suitability | reaction type: C-C Bond Formation |
| | (3-Ethoxycarbonyl-2-oxopropyl)triphenylphosphonium chloride Preparation Products And Raw materials |
|