|
|
| | 3-O-Benzyl-1,2,5,6-di-O-isopropylidene-alpha-D-glucofuranose Basic information |
| Product Name: | 3-O-Benzyl-1,2,5,6-di-O-isopropylidene-alpha-D-glucofuranose | | Synonyms: | 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-7,7-dimethyl-4-phenylmethoxy-2,6,8- trioxabicyclo[3.3.0]octane;1,2:5,6-Bis-o-(1-methylethylidene)-3-o-(phenylmethyl)-alpha-D-glucofuranose;alpha-D-Glucofuranose, 1,2:5,6-bis-o-(1-methylethylidene)-3-o-(phenylmethyl)-;Brn 0043822;1,2:5,6-Bis-O-(1-Methylethylidene)-3-O-(phenylMethyl)-α-D-glucofuranose;NSC 56267;a-D-Glucofuranose, 1,2:5,6-bis-O-(1-Methylethylidene)-3-O-(phenylMethyl)-;5,6-di-O-isopropylidene-α-D-glucofuranose | | CAS: | 18685-18-2 | | MF: | C19H26O6 | | MW: | 350.41 | | EINECS: | | | Product Categories: | Carbohydrates & Derivatives;Carbohydrates | | Mol File: | 18685-18-2.mol |  |
| | 3-O-Benzyl-1,2,5,6-di-O-isopropylidene-alpha-D-glucofuranose Chemical Properties |
| Melting point | 60-65 C | | Boiling point | 127-128 C | | density | 1.094 | | RTECS | LZ4918000 | | refractive index | 1.4925 | | storage temp. | Refrigerator | | solubility | Soluble in chloroform | | form | Oil | | color | Colorless to Pale Yellow | | InChI | InChI=1/C19H26O6/c1-18(2)21-11-13(23-18)14-15(20-10-12-8-6-5-7-9-12)16-17(22-14)25-19(3,4)24-16/h5-9,13-17H,10-11H2,1-4H3/t13-,14-,15+,16-,17-/s3 | | InChIKey | ZHFVGOMEUGAIJX-KLFIJBQVNA-N | | SMILES | [C@@H]1(OCC2=CC=CC=C2)[C@H]2OC(C)(C)O[C@H]2O[C@]1([H])[C@@]1([H])COC(C)(C)O1 |&1:0,9,15,17,19,r| |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36 | | HS Code | 2940000080 | | Toxicity | mouse,LD50,oral,> 4gm/kg (4000mg/kg),Arzneimittel-Forschung. Drug Research. Vol. 29, Pg. 986, 1979. |
| | 3-O-Benzyl-1,2,5,6-di-O-isopropylidene-alpha-D-glucofuranose Usage And Synthesis |
| Chemical Properties | Light Yellow Oil | | Uses | A derivative of glucofuranose. |
| | 3-O-Benzyl-1,2,5,6-di-O-isopropylidene-alpha-D-glucofuranose Preparation Products And Raw materials |
|