| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | (6S)-5,6,7,8-Tetrahydro-L-biopterin sulfate Basic information |
| Product Name: | (6S)-5,6,7,8-Tetrahydro-L-biopterin sulfate | | Synonyms: | Sapropterin Related Compound ((6S)-5,6,7,8-Tetrahydro-L-Biopterin Sulfate);(6S)-2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-5,6,7,8-tetrahydro-1H-pteridin-4-one;(6S)-2-Amino-6-[(1R,2S)-1,2-dihydroxypropyl]-5,6,7,8-4-tetrahydro-(1H)-pteridinone sulfate salt;(6S)-5,6,7,8-Tetrahydro-L-erythro-biopterin sulfate;(6S)-BH4 SULFATE;(6S)-5,6,7,8-Tetrahydro-L-erythro-biopterin;(6S)-5,6,7,8-Tetrahydro-L-erythro-biopterin sulfate >=96% (HPLC);(S)-2-Amino-6-((1R,2S)-1,2-dihydroxypropyl)-5,6,7,8-tetrahydropteridin-4(1H)-one sulfate | | CAS: | 109784-74-9 | | MF: | C9H17N5O7S | | MW: | 339.33 | | EINECS: | | | Product Categories: | | | Mol File: | 109784-74-9.mol |  |
| | (6S)-5,6,7,8-Tetrahydro-L-biopterin sulfate Chemical Properties |
| storage temp. | -20°C | | solubility | Water: 10 mg/ml | | form | A solid | | Water Solubility | Water: 10 mg/ml | | InChI | 1S/C9H15N5O3.H2O4S/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7;1-5(2,3)4/h3-4,6,12,15-16H,2H2,1H3,(H4,10,11,13,14,17);(H2,1,2,3,4)/t3-,4-,6-;/m0./s1 | | InChIKey | YCBVHESKFWFUMG-NXYGYYFTSA-N | | SMILES | O=C1C2=C(NC[C@]([C@@H](O)[C@@H](O)C)([H])N2)NC(N)=N1.O=S(O)(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (6S)-5,6,7,8-Tetrahydro-L-biopterin sulfate Usage And Synthesis |
| Description | (6S)-5,6,7,8-tetrahydro-L-Biopterin is a diastereomer of (6R)-5,6,7,8-tetrahydro-L-biopterin (Item No. 81880), a cofactor for tyrosine, tryptophan, and phenylalanine hydroxylases and nitric oxide synthase (NOS).1,2,3,4WARNING This product is not for human or veterinary use. | | Biochem/physiol Actions | Important metabolite of the folate biosynthesis pathway. Stereochemistry of biopterin cofactor, tetrahydrobiopterin biosynthesis, regeneration and functions. |
| | (6S)-5,6,7,8-Tetrahydro-L-biopterin sulfate Preparation Products And Raw materials |
|