| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
Glycidic acid methyl ester manufacturers
|
| | Glycidic acid methyl ester Basic information |
| Product Name: | Glycidic acid methyl ester | | Synonyms: | Methyl oxiranecarboxylate;Glycidic acid methyl ester;Oxiranecarboxylic acid, Methyl ester;2-Oxiranecarboxylic acid, methyl ester;Methyl 2-oxiranecarboxylate;methyl oxirane-2-carboxylate - [M23745];Methyl 2,3-epoxypropionate;Methyl oxirane-2-carboxylate | | CAS: | 4538-50-5 | | MF: | C4H6O3 | | MW: | 102.09 | | EINECS: | | | Product Categories: | | | Mol File: | 4538-50-5.mol |  |
| | Glycidic acid methyl ester Chemical Properties |
| Melting point | >300°C | | Boiling point | 97.4±15.0 °C(Predicted) | | density | 1.246±0.06 g/cm3(Predicted) | | storage temp. | -20°C, Inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C4H6O3/c1-6-4(5)3-2-7-3/h3H,2H2,1H3 | | InChIKey | YKNYRRVISWJDSR-UHFFFAOYSA-N | | SMILES | O1CC1C(OC)=O |
| RIDADR | UN1993 | | HazardClass | 3 | | HS Code | 2916200090 |
| | Glycidic acid methyl ester Usage And Synthesis |
| Uses | Methyl Oxirane-2-carboxylate is an intermediate used in the synthesis of DL-Indole-3-lactic Acid-d5 (I627102), which is the isotope labelled analog of DL-Indole-3-lactic Acid (I627100); a reagent in the synthesis of 2-hydroxy-1-(1H-indol-3-yl)-4-methylpentan-3-one which has weak antibacterial activity against 16 bacterial strains, including Escherichia coli, Bacillus subtilis and Staphylococcus aureus. DL-Indole-3-lactic Acid is also used in the preparation of Monatin, a natural sweet peptidomimetic. |
| | Glycidic acid methyl ester Preparation Products And Raw materials |
|