| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
L 741626 manufacturers
- L-741626
-
- $30.00
-
2026-06-02
- CAS:81226-60-0
- Purity: 98.90%
- Supply Ability: 10g
|
| | L 741626 Basic information |
| Product Name: | L 741626 | | Synonyms: | 3-(4-(4-Chlorophenyl-4-hydroxypiperidino)methyl)indole;4-(4-CHLOROPHENYL)-1-(1H-INDOL-3-YL METHYL)PIPERIDIN-4-OL;receptor,selective,TNF-α,Inhibitor,dopamine,Dopamine Receptor,production,L-741626,L 741626,L741626,inhibit;4-Piperidinol, 4-(4-chlorophenyl)-1-(1H-indol-3-ylmethyl)-;L-741,626, D2 antagonist;L-741626, 10 mM in DMSO | | CAS: | 81226-60-0 | | MF: | C20H21ClN2O | | MW: | 340.85 | | EINECS: | | | Product Categories: | | | Mol File: | 81226-60-0.mol |  |
| | L 741626 Chemical Properties |
| Boiling point | 548.8±50.0 °C(Predicted) | | density | 1.311±0.06 g/cm3(Predicted) | | storage temp. | room temp | | solubility | DMSO: ≥20mg/mL | | form | powder | | pka | 13.87±0.20(Predicted) | | color | white to beige | | InChI | 1S/C20H21ClN2O/c21-17-7-5-16(6-8-17)20(24)9-11-23(12-10-20)14-15-13-22-19-4-2-1-3-18(15)19/h1-8,13,22,24H,9-12,14H2 | | InChIKey | LLBLNMUONVVVPG-UHFFFAOYSA-N | | SMILES | OC1(CCN(CC1)Cc2c[nH]c3ccccc23)c4ccc(Cl)cc4 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L 741626 Usage And Synthesis |
| Uses | L-741,626 is a selective D2DR inhibitor. Also, it is a G protein-coupled receptors antagonists and inverse agonists. | | Uses | L-741,626 has been used as selective dopamine (D2) receptor antagonist to study its effects on the uptake of dopamine in human embryonic kidney 293 (HEK293) cells. It has also been used as a D2 receptor antagonist to study its effects on thyrotropin-releasing hormone (TRH) induced prolactin release. | | Definition | ChEBI: 4-(4-chlorophenyl)-1-(1H-indol-3-ylmethyl)-4-piperidinol is a member of piperidines. | | Hazard | A poison. | | Biochem/physiol Actions | L-741,626 is a selective dopamine (D2) receptor antagonist. | | storage | Store at RT |
| | L 741626 Preparation Products And Raw materials |
|