| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1,3-Diallylurea Basic information |
| Product Name: | 1,3-Diallylurea | | Synonyms: | 1,3-Bis(2-propenyl)urea;1,3-Di(2-propenyl)urea;1,3-Diallylurea,99%;Sinapoline;Urea, 1,3-diallyl-;Urea, N,N'-di-2-propenyl-;N,N'-DIALLYLUREA;1,3-DIALLYLUREA 99% | | CAS: | 1801-72-5 | | MF: | C7H12N2O | | MW: | 140.18 | | EINECS: | 217-291-7 | | Product Categories: | Carbonyl Compounds;Organic Building Blocks;Ureas | | Mol File: | 1801-72-5.mol |  |
| | 1,3-Diallylurea Chemical Properties |
| Melting point | 90-93 °C(lit.) | | Boiling point | 56°C/10mmHg(lit.) | | density | 1.0897 (rough estimate) | | refractive index | 1.4880 (estimate) | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 13.86±0.46(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C7H12N2O/c1-3-5-8-7(10)9-6-4-2/h3-4H,1-2,5-6H2,(H2,8,9,10) | | InChIKey | QRWVOJLTHSRPOA-UHFFFAOYSA-N | | SMILES | N(CC=C)C(NCC=C)=O | | CAS DataBase Reference | 1801-72-5(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2924190090 |
| | 1,3-Diallylurea Usage And Synthesis |
| Chemical Properties | WHITE TO LIGHT YELLOW CRYSTALS OR CRYST. POWDER | | Uses | 1,3-Diallylurea has a good effect on preventing and controlling aphids. |
| | 1,3-Diallylurea Preparation Products And Raw materials |
|