| Company Name: |
Asperillum Ltm Gold
|
| Tel: |
15920419256 |
| Email: |
huangxishan13@foxmail.com |
| Products Intro: |
Product Name:bassiatin
CAS:65454-13-9
|
lateritin manufacturers
- Lateritin
-
- $109.00 / 1mg
-
2026-01-30
- CAS:65454-13-9
- Min. Order:
- Purity: 99.23%
- Supply Ability: 10g
|
| | lateritin Basic information | | Uses |
| Product Name: | lateritin | | Synonyms: | lateritin;(3S,6R)-Lateritin;4-Methyl-6-(1-methylethyl)-3-(phenylmethyl)-2,5-morpholinedione;Lateritine;bassiatin;3-Benzyl-6-isopropyl-4-methylmorpholine-2,5-dione;Lateritin, 10 mM in DMSO | | CAS: | 65454-13-9 | | MF: | C15H19NO3 | | MW: | 261.319 | | EINECS: | | | Product Categories: | Antibiotic | | Mol File: | 65454-13-9.mol |  |
| | lateritin Chemical Properties |
| form | solid | | color | Off-white | | InChI | InChI=1S/C15H19NO3/c1-10(2)13-14(17)16(3)12(15(18)19-13)9-11-7-5-4-6-8-11/h4-8,10,12-13H,9H2,1-3H3 | | InChIKey | YOKBTBNVNCFOBF-UHFFFAOYSA-N | | SMILES | C1(CC2C=CC=CC=2)C(=O)OC(C(C)C)C(=O)N1C |
| | lateritin Usage And Synthesis |
| Uses | LATERITIN is an acyl-CoA that is used as an inhibitor of cholesterol acyltransferase (ACAT) and platelet aggregation. | | Definition | ChEBI: A member of the class of morpholines that is morpholine-2,5-dione substituted by a benzyl, isopropyl and a methyl group at positions 3, 6 and 4 respectively. It is isolated from the culture broth of the fungus Beauveria bassiana and acts as a
latelet aggregation inhibitor. | | storage | +4°C |
| | lateritin Preparation Products And Raw materials |
|