nevadensin manufacturers
- Nevadensin
-
- $39.00
-
2026-06-02
- CAS:10176-66-6
- Purity: 99.85%
- Supply Ability: 10g
|
| | nevadensin Basic information |
| Product Name: | nevadensin | | Synonyms: | 2-(4-Methoxyphenyl)-5,7-dihydroxy-6,8-dimethoxy-4H-1-benzopyran-4-one;4',6,8-Trimethoxy-5,7-dihydroxyflavone;Nevadensin A;4H-1-Benzopyran-4-one, 5,7-dihydroxy-6,8-dimethoxy-2-(4-methoxyphenyl)-;5,7-Dihydroxy-6,8-dimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one;5,7-Dihydroxy-6,8,4'-trimethoxyflavone;5,7-Dihydroxy-6,8-dimethoxy-2-(4-methoxyphenyl)-4H-chromen-4-one;pharmacological,selective,Inhibitor,flavonoid,Nevadensin,effect,Bacterial,natural,inhibit,inhibition | | CAS: | 10176-66-6 | | MF: | C18H16O7 | | MW: | 344.32 | | EINECS: | | | Product Categories: | | | Mol File: | 10176-66-6.mol |  |
| | nevadensin Chemical Properties |
| Melting point | 199-200℃ (chloroform methanol ) | | Boiling point | 615.0±55.0 °C(Predicted) | | density | 1.387±0.06 g/cm3(Predicted) | | storage temp. | 4°C, protect from light | | solubility | Soluble in DMSO | | form | Solid | | pka | 6.84±0.40(Predicted) | | color | Light yellow to yellow | | biological source | plant | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChI | 1S/C18H16O7/c1-22-10-6-4-9(5-7-10)12-8-11(19)13-14(20)17(23-2)15(21)18(24-3)16(13)25-12/h4-8,20-21H,1-3H3 | | InChIKey | KRFBMPVGAYGGJE-UHFFFAOYSA-N | | SMILES | [o]1c2c([c](cc1c3ccc(cc3)OC)=O)c(c(c(c2OC)O)OC)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | nevadensin Usage And Synthesis |
| Uses | It is a natural product derived from plant source th at finds application in compound screening libraries, metabolomics, phytochemical, and pharmaceutical research. | | Definition | ChEBI: A trimethoxyflavone that is flavone substituted by methoxy groups at positions 6, 8 and 4' and hydroxy groups at positions 5 and 7 respectively. | | Biological Activity | Nevadensin exhibits a wide range of significant biological activities including hypotensive, anti-tubercular, antimicrobial, anti-inflammatory, anti-tumour and anti-cancer activities. It displays high inhibition potency and selectivity towards hCE1. |
| | nevadensin Preparation Products And Raw materials |
|