| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Benzyl-2,3,4,5,6-d5 chloride Basic information |
| Product Name: | Benzyl-2,3,4,5,6-d5 chloride | | Synonyms: | BENZYL-2,3,4,5,6-D5 CHLORIDE, 98 ATOM % D;Benzene-d5, (chloromethyl)-;α-chlorotoluene-2,3,4,5,6-d5;Benzyl-d5 Chloride;1-ChloroMethylbenzene-d5;6-(ChloroMethyl)benzene-1,2,3,4,5-d5;Benzyl Chloride-d5;ChlorophenylMethane-d5 | | CAS: | 68661-11-0 | | MF: | C7H7Cl | | MW: | 126.58 | | EINECS: | | | Product Categories: | Aromatics;Intermediates & Fine Chemicals;Isotope Labelled Compounds;Pharmaceuticals | | Mol File: | 68661-11-0.mol |  |
| | Benzyl-2,3,4,5,6-d5 chloride Chemical Properties |
| Melting point | −43 °C(lit.) | | Boiling point | 177-181 °C(lit.) | | density | 1.144 g/mL at 25 °C | | refractive index | n20/D 1.538(lit.) | | Fp | 165 °F | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Oil | | color | Clear Colourless | | InChI | 1S/C7H7Cl/c8-6-7-4-2-1-3-5-7/h1-5H,6H2/i1D,2D,3D,4D,5D | | InChIKey | KCXMKQUNVWSEMD-RALIUCGRSA-N | | SMILES | [2H]c1c([2H])c([2H])c(CCl)c([2H])c1[2H] |
| Hazard Codes | T | | Risk Statements | 45-46-23/24/25-34 | | Safety Statements | 53-23-26-36/37/39-45 | | RIDADR | UN 1738 6.1/PG 2 | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Inhalation
Acute Tox. 4 Oral
Carc. 1B
Eye Dam. 1
Flam. Liq. 3
Skin Irrit. 2
Skin Sens. 1
STOT RE 2 Oral
STOT SE 3 |
| | Benzyl-2,3,4,5,6-d5 chloride Usage And Synthesis |
| Uses | A labelled isotope of Benzyl Chloride. |
| | Benzyl-2,3,4,5,6-d5 chloride Preparation Products And Raw materials |
|