| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Benzyl-d7 chloride Basic information |
| Product Name: | Benzyl-d7 chloride | | Synonyms: | ALPHA-CHLOROTOLUENE-D7;BENZYL CHLORIDE (D7);alpha-bromo(2H7)toluene;BENZYL-D7 CHLORIDE, 99+ ATOM % D;Benzene-d5, (chloromethyl-d2)-;α-chlorotoluene-d7;a-Bromo(-{2}-H7)toluene.;1-(CHLOROMETHYL)-2,3,4,5,6-PENTADEUTERIO-BENZENE | | CAS: | 59502-05-5 | | MF: | C7ClD7 | | MW: | 133.63 | | EINECS: | 261-790-2 | | Product Categories: | | | Mol File: | 59502-05-5.mol |  |
| | Benzyl-d7 chloride Chemical Properties |
| Melting point | -43 °C(lit.) | | Boiling point | 177-181 °C(lit.) | | density | 1.160 g/mL at 25 °C | | refractive index | n20/D 1.5374(lit.) | | Fp | 165 °F | | solubility | Chloroform (Sparingly), Methanol (Sparingly) | | form | Oil | | color | Colourless | | InChI | 1S/C7H7Cl/c8-6-7-4-2-1-3-5-7/h1-5H,6H2/i1D,2D,3D,4D,5D,6D2 | | InChIKey | KCXMKQUNVWSEMD-XZJKGWKKSA-N | | SMILES | [2H]c1c([2H])c([2H])c(c([2H])c1[2H])C([2H])([2H])Cl | | CAS DataBase Reference | 59502-05-5 | | CAS Number Unlabeled | 100-44-7 |
| Hazard Codes | T | | Risk Statements | 22-23-37/38-40-41-48/22-45 | | Safety Statements | 36/37-38-45-53 | | RIDADR | UN 1738 6.1/PG 2 | | WGK Germany | 3 | | HazardClass | 6.1(a) | | PackingGroup | II | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Inhalation
Acute Tox. 4 Oral
Carc. 1B
Eye Dam. 1
Skin Irrit. 2
Skin Sens. 1
STOT RE 2 Oral
STOT SE 3 |
| | Benzyl-d7 chloride Usage And Synthesis |
| Chemical Properties | clear colourless liquid | | Uses | - Acid-catalyzed reactions requiring deuterated Acid
- NMR solvent preparation with precise pH control
- Isotope exchange studies in organic synthesis
- Chlorination reaction mechanism studies |
| | Benzyl-d7 chloride Preparation Products And Raw materials |
|