- PYRENE-4,5-QUINONE
-
- $120.00
-
2026-02-02
- CAS:6217-22-7
- Min. Order: 1g
- Purity: 98%min
- Supply Ability: 200tons
- PYRENE-4,5-QUINONE
-
- $1.00
-
2020-01-15
- CAS:6217-22-7
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 100kg
|
| | PYRENE-4,5-QUINONE Basic information |
| | PYRENE-4,5-QUINONE Chemical Properties |
| Melting point | 310 °C | | Boiling point | 467.6±12.0 °C(Predicted) | | density | 1.433±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | Light Brown to Dark Brown | | InChI | InChI=1S/C16H8O2/c17-15-11-5-1-3-9-7-8-10-4-2-6-12(16(15)18)14(10)13(9)11/h1-8H | | InChIKey | JKCATVQPENLMQJ-UHFFFAOYSA-N | | SMILES | C1=C2C3C4C(C=C2)=CC=CC=4C(=O)C(=O)C=3C=C1 |
| | PYRENE-4,5-QUINONE Usage And Synthesis |
| Uses | PYRENE-4,5-QUINONE is used as a ligand in the synthesis of MOF materials. | | Definition | ChEBI: Pyrene-4,5-dione is a member of pyrenes. |
| | PYRENE-4,5-QUINONE Preparation Products And Raw materials |
|