| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | 2'-C-Methylguanosine Basic information |
| | 2'-C-Methylguanosine Chemical Properties |
| Boiling point | 733.1±70.0 °C(Predicted) | | density | 2.03 | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | solubility | H2O: soluble5mg/mL, clear (warmed) | | pka | 13.31±0.70(Predicted) | | form | powder | | color | white to beige | | InChI | 1S/C11H15N5O5/c1-11(20)6(18)4(2-17)21-9(11)16-3-13-5-7(16)14-10(12)15-8(5)19/h3-4,6,9,17-18,20H,2H2,1H3,(H3,12,14,15,19)/t4-,6-,9-,11-/m1/s1 | | InChIKey | NVKAMPJSWMHVDK-GITKWUPZSA-N | | SMILES | C[C@]1([C@@H]([C@H](O[C@H]1N2C=NC3=C2N=C(NC3=O)N)CO)O)O |
| WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2'-C-Methylguanosine Usage And Synthesis |
| Uses | A nucleoside derivative as antiviral, antitumor, and antidiabetic prodrug agents | | Uses | 2’C-β-Methyl Guanosine is an anti-HCV agent. 2’C-β-Methyl Guanosine is an intermediate in the synthesis of novel double prodrug INX-08189, a new clinical candidate for hepatitis C virus. | | Uses | 2’-C-β-Methyl Guanosine is an anti-HCV agent. 2’-C-β-Methyl Guanosine is an intermediate in the synthesis of novel double prodrug INX-08189, a new clinical candidate for hepatitis C virus. |
| | 2'-C-Methylguanosine Preparation Products And Raw materials |
|