| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
Styrene-alpha,beta,beta-d3 manufacturers
|
| | Styrene-alpha,beta,beta-d3 Basic information |
| Product Name: | Styrene-alpha,beta,beta-d3 | | Synonyms: | STYRENE-A,B,B-D3;STYRENE (VINYL-1,2,2-D3);STYRENE-ALPHA,BETA,BETA-D3 98% CHEMICALPURITY, 98 ATOM% D;Styrene-alpha,|beta|-D3;styrene-2,3,3-d3;Styrene-ALPHA,B,B-d3;Styrene-α, β, β-d3;Styrene-d3, stab. | | CAS: | 3814-93-5 | | MF: | C8H5D3 | | MW: | 107.17 | | EINECS: | | | Product Categories: | Alphabetical Listings;Q-S;Stable Isotopes | | Mol File: | 3814-93-5.mol |  |
| | Styrene-alpha,beta,beta-d3 Chemical Properties |
| Melting point | -31 °C | | Boiling point | 145-146 °C (lit.) | | density | 0.935 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.546(lit.) | | Fp | 31 °C | | storage temp. | 2-8°C | | form | liquid | | InChI | 1S/C8H8/c1-2-8-6-4-3-5-7-8/h2-7H,1H2/i1D2,2D | | InChIKey | PPBRXRYQALVLMV-FUDHJZNOSA-N | | SMILES | [2H]\C([2H])=C(\[2H])c1ccccc1 | | CAS Number Unlabeled | 100-42-5 |
| Hazard Codes | Xn | | Risk Statements | 10-20-36/38 | | Safety Statements | 23 | | RIDADR | UN 2055 3/PG 3 | | WGK Germany | 3 | | HS Code | 2845901000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Inhalation
Aquatic Chronic 3
Asp. Tox. 1
Eye Irrit. 2
Flam. Liq. 3
Repr. 2
Skin Irrit. 2
STOT RE 1 Inhalation
STOT SE 3 |
| | Styrene-alpha,beta,beta-d3 Usage And Synthesis |
| Uses | Styrene-alpha,beta,beta-d3 (CAS# 3814-93-5) is a useful isotopically labeled research compound. |
| | Styrene-alpha,beta,beta-d3 Preparation Products And Raw materials |
|