| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:β-cis-Styrene-d CAS:21370-59-2 Package:100Mg,10Mg
|
| Company Name: |
Chemsky (shanghai) International Co.,Ltd
|
| Tel: |
021-50135380 |
| Email: |
shchemsky@sina.com |
| Products Intro: |
Product Name:cis-Styrene-(β)-d;(1Z)-Ethenyl-2-d- CAS:21370-59-2 Purity:98+% Package:1Mg;5Mg;10Mg;50Mg;100Mg;500Mg
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:cis-Styrene-(β)-d CAS:21370-59-2 Purity:NULL Package:100mg;10mg Remarks:NULL
|
|
| | CIS-STYRENE-BETA-D Basic information |
| | CIS-STYRENE-BETA-D Chemical Properties |
| Boiling point | 50-51 °C/25 mmHg(lit.) | | density | 0.917 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.546(lit.) | | Fp | 31 °C | | storage temp. | 2-8°C | | InChI | 1S/C8H8/c1-2-8-6-4-3-5-7-8/h2-7H,1H2/i1D/b2-1- | | InChIKey | PPBRXRYQALVLMV-NYLCSIPTSA-N | | SMILES | [H]\C([2H])=C(/[H])c1ccccc1 |
| Hazard Codes | Xn | | Risk Statements | 10-20-36/38 | | Safety Statements | 23 | | RIDADR | UN 2055 3/PG 3 | | WGK Germany | WGK 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Inhalation Aquatic Chronic 3 Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 |
| | CIS-STYRENE-BETA-D Usage And Synthesis |
| Uses | CIS-STYRENE-BETA-D is used in the manufacturing plastics; synthetic rubber; resins; insulator. | | Uses | Labelled cis-Styrene (S687790). Used in the manufacturing plastics; synthetic rubber; resins; insulator. |
| | CIS-STYRENE-BETA-D Preparation Products And Raw materials |
|