| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (1-Benzyl-4-piperidyl)methanol Basic information | | Synthesis |
| | (1-Benzyl-4-piperidyl)methanol Chemical Properties |
| Boiling point | 135-138°C (0.2 mmHg) | | density | 1.056±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 14.94±0.10(Predicted) | | Appearance | White to yellow Oil | | InChI | InChI=1S/C13H19NO/c15-11-13-6-8-14(9-7-13)10-12-4-2-1-3-5-12/h1-5,13,15H,6-11H2 | | InChIKey | FLQPYEOKVZYXRL-UHFFFAOYSA-N | | SMILES | N1(CC2=CC=CC=C2)CCC(CO)CC1 | | CAS DataBase Reference | 67686-01-5(CAS DataBase Reference) |
| Hazard Codes | Xi,T | | Risk Statements | 25 | | Safety Statements | 24/25-45 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | (1-Benzyl-4-piperidyl)methanol Usage And Synthesis |
| Synthesis | Charge toluene (100
mL) in a round bottom flask along with vitride (26 g, 0.12
mol) in an inert atmosphere. N-Benzyl ethyl isonipecotate (40 g, 0.16 mol) was added slowly in portions to the reaction
mass. The mixture was stirred at room temperature for 2 h.
After completion of the reaction the mass was quenched with
chilled water. Toluene phase was separated and dried over
anhydrous sodium sulfate. Toluene was removed under vacuum
to get (1-Benzyl-4-piperidyl)methanol( 26.9 g, 82 %).
 | | Chemical Properties | Colorless liquid |
| | (1-Benzyl-4-piperidyl)methanol Preparation Products And Raw materials |
|