| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
4,5,6,7-Tetrahydro-benzo[b]thiophene-3-carboxylic acid manufacturers
|
| | 4,5,6,7-Tetrahydro-benzo[b]thiophene-3-carboxylic acid Basic information |
| Product Name: | 4,5,6,7-Tetrahydro-benzo[b]thiophene-3-carboxylic acid | | Synonyms: | 4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid(SALTDATA: FREE);4,5,6,7-Tetrahydro-ben[B]thiophene-3-carboxylic acid;2-broMo-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylic acid;4,5,6,7-Tetrahydrobenzothiophene-3-carboxylic acid;4,5,6,7-Tetrahy;Benzo[b]thiophene-3-carboxylic acid, 4,5,6,7-tetrahydro-;4,5,6,7-Tetrahydrobenzo[b]thiophene-3-carboxylic acid 97%;4,5,6,7-TETRAHYDRO-BENZO[B]THIOPHENE-3-CARBOXYLIC ACID ISO 9001：2015 REACH | | CAS: | 19156-54-8 | | MF: | C9H10O2S | | MW: | 182.24 | | EINECS: | 624-553-8 | | Product Categories: | | | Mol File: | 19156-54-8.mol | ![4,5,6,7-Tetrahydro-benzo[b]thiophene-3-carboxylic acid Structure](CAS/GIF/19156-54-8.gif) |
| | 4,5,6,7-Tetrahydro-benzo[b]thiophene-3-carboxylic acid Chemical Properties |
| Melting point | 179-184°C | | Boiling point | 350.5±42.0 °C(Predicted) | | density | 1.317±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 4.35±0.20(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C9H10O2S/c10-9(11)7-5-12-8-4-2-1-3-6(7)8/h5H,1-4H2,(H,10,11) | | InChIKey | TUZZQEHPGHKGRJ-UHFFFAOYSA-N | | SMILES | C12CCCCC=1C(C(O)=O)=CS2 |
| WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids |
| | 4,5,6,7-Tetrahydro-benzo[b]thiophene-3-carboxylic acid Usage And Synthesis |
| Synthesis | The general procedure for the synthesis of 4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylic acid from ethyl 4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylate was as follows: general method: potassium hydroxide (KOH, 1.7 g, 30 mmol) was added to ethyl 4,5,6,7-tetrahydrobenzo[B]thiophene-3-carboxylate (30 mmol) in aqueous (H2O. 20 mL) emulsion. The mixture was heated under vigorous stirring until a clarified solution was obtained (about 1 h), then stirring was continued for 30 min. The reaction solution was cooled to room temperature and washed with toluene (PhMe); the aqueous layer was separated and acidified with hydrochloric acid (HCl) to pH 4. The precipitate was collected by filtration and recrystallized with a solvent mixture of ethanol (EtOH)-N,N-dimethylformamide (DMF). | | References | [1] Journal of Medicinal Chemistry, 2003, vol. 46, # 12, p. 2446 - 2455
[2] Chemistry of Heterocyclic Compounds, 2015, vol. 50, # 12, p. 1748 - 1755
[3] Khim. Geterotsikl. Soedin., 2014, vol. 50, # 12, p. 1900 - 1907,8 |
| | 4,5,6,7-Tetrahydro-benzo[b]thiophene-3-carboxylic acid Preparation Products And Raw materials |
|