| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- (+)-Taddol
-
- $1.00
-
2019-08-30
- CAS:93379-49-8
- Min. Order: 1KG
- Purity: 95%-99%
- Supply Ability: 100KG
|
| | (+)-Taddol Basic information |
| Product Name: | (+)-Taddol | | Synonyms: | (+)-4,5-BIS[HYDROXY(DIPHENYL)METHYL]-2,2-DIMETHYL-1,3-DIOXOLANE;(4S,5S)-2,2-DIMETHYL-ALPHA,ALPHA,ALPHA',ALPHA'-TETRAPHENYLDIOXOLANE-4,5-DIMETHANOL;(4S,5S)-4,5-BIS(DIPHENYLHYDROXYMETHYL)-2,2-DIMETHYL-DIOXOLANE;(+)-2,3-O-ISOPROPYLIDENE-1,1,4,4-TETRAPHENYL-D-THREITOL;(2S,3S)-(+)-1,1,4,4-TETRAPHENYL-2,3-(2-PROPYLIDENEDIOXY)-BUTANE-1,4-DIOL;(2S,3S)-2,3-O-ISOPROPYLIDENE-1,1,4,4-TETRAPHENYL-1,2,3,4-BUTANETETROL;(2S,3S)-(+)-4,5-BIS(DIPHENYLHYDROXYMETHYL)-2,2-DIMETHYL-1,3-DIOXOLANE;(+)-TADDOL | | CAS: | 93379-49-8 | | MF: | C31H30O4 | | MW: | 466.57 | | EINECS: | | | Product Categories: | chiral;Asymmetric Synthesis;Dioxanes & Dioxolanes;Dioxolanes;Synthetic Organic Chemistry;TADDOL Series;Chiral Oxygen | | Mol File: | 93379-49-8.mol |  |
| | (+)-Taddol Chemical Properties |
| Melting point | 193-196 °C(lit.) | | alpha | -62.6 º (c=1 in chloroform) | | Boiling point | 633.2±50.0 °C(Predicted) | | density | 1.200±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | pka | 12.28±0.29(Predicted) | | color | White to Almost white | | Optical Rotation | [α]19/D +67°, c = 1 in chloroform | | BRN | 4724097 | | InChIKey | RNSJHECWLNVNFE-LOYHVIPDSA-N | | SMILES | C(O)(C1C=CC=CC=1)(C1C=CC=CC=1)[C@H]1OC(C)(C)O[C@@H]1C(O)(C1C=CC=CC=1)C1C=CC=CC=1 |&1:14,20,r| | | CAS DataBase Reference | 93379-49-8(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids |
| | (+)-Taddol Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | Ligand for enantioselective Lewis-acid mediated Diels-Alder, allyltitanation of aldehydes, and Michael-Mukaiyama additions promoted by chiral Ti-complexes. | | Preparation | Preparative Methods of (4R,5R)-2,2-Dimethyl-4,5-bis(hydroxydiphenylmethyl)-1,3-dioxolane: chiral titanates are usually prepared by mixing dichlorodiisopropoxytitanium and a
chiral 1,4-diol in toluene. Other solvents such as ether and dichloromethane can also be employed. The
alcohol exchange reaction takes place immediately at rt. Wherever necessary, liberated isopropyl alcohol is removed by azeotropic removal with toluene. The chiral 1,4-diols are prepared from dimethyl (or diethyl)
tartrate by a two-step procedure comprising acetalization followed by the addition of an aryl Grignard
reagent. | | storage |
Chiral titanates are usually prepared just before use under argon
atmosphere. Care should be taken to avoid moisture, especially when a catalytic amount of the reagent is used.
|
| | (+)-Taddol Preparation Products And Raw materials |
|