|
|
| | 3-Bromo-5-nitrobenzyl alcohol Basic information |
| Product Name: | 3-Bromo-5-nitrobenzyl alcohol | | Synonyms: | 3-Bromo-5-nitrobenzyl alcohol;(3-Bromo-5-nitrophenyl)methanol, 3-Bromo-5-(hydroxymethyl)nitrobenzene;(3-bromo-5-nitrophenyl)methanol;3-Bromo-5-nitrobenzylalcohol97%;3-Bromo-5-nitrobenzyl alcohol 97%;Benzenemethanol, 3-bromo-5-nitro-;3-Bromo-5-nitrobenzenemethanol | | CAS: | 139194-79-9 | | MF: | C7H6BrNO3 | | MW: | 232.03 | | EINECS: | | | Product Categories: | | | Mol File: | 139194-79-9.mol |  |
| | 3-Bromo-5-nitrobenzyl alcohol Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C7H6BrNO3/c8-6-1-5(4-10)2-7(3-6)9(11)12/h1-3,10H,4H2 | | InChIKey | WIXGOPRKQQGTHO-UHFFFAOYSA-N | | SMILES | C1(CO)=CC([N+]([O-])=O)=CC(Br)=C1 |
| | 3-Bromo-5-nitrobenzyl alcohol Usage And Synthesis |
| | 3-Bromo-5-nitrobenzyl alcohol Preparation Products And Raw materials |
|