|
|
| | 5-Bromo-2-methyl-3-nitrobenzoic acid Basic information |
| Product Name: | 5-Bromo-2-methyl-3-nitrobenzoic acid | | Synonyms: | Benzoic acid, 5-broMo-2-Methyl-3-nitro-;AKOS BB-9545;-3-nitrobenzoic acid;5-Bromo-2-methyl-3-nitrobenzoicAci;5-BROMO-2-METHYL-3-NITROBENZOIC ACID ISO 9001:2015 REACH;5-Bromo-2-methyl-3-nitrobenzoic acid | | CAS: | 107650-20-4 | | MF: | C8H6BrNO4 | | MW: | 260.04 | | EINECS: | | | Product Categories: | | | Mol File: | 107650-20-4.mol |  |
| | 5-Bromo-2-methyl-3-nitrobenzoic acid Chemical Properties |
| Boiling point | 377.0±42.0 °C(Predicted) | | density | 1.777±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 2+-.0.20(Predicted) | | InChI | InChI=1S/C8H6BrNO4/c1-4-6(8(11)12)2-5(9)3-7(4)10(13)14/h2-3H,1H3,(H,11,12) | | InChIKey | DXUUJILVHXQDCV-UHFFFAOYSA-N | | SMILES | C1(C(C)=C(C(=O)O)C=C(Br)C=1)[N+]([O-])=O |
| | 5-Bromo-2-methyl-3-nitrobenzoic acid Usage And Synthesis |
| Uses | 5-Bromo-2-methyl-3-nitrobenzoic Acid is a reactant in the preparation of EPZ005687 (E592200), a potent and selective inhibitor of EZH2. | | Synthesis | General procedure for the synthesis of 2-methyl-3-nitro-5-bromobenzoic acid from 2-methyl-3-nitrobenzoic acid: N-bromosuccinimide (15 g, 84.3 mmol) was added to a concentrated sulfuric acid solution (60 mL) containing 2-methyl-3-nitrobenzoic acid (15 g, 82.8 mmol). The reaction mixture was stirred at room temperature overnight. Upon completion of the reaction, the reaction solution was slowly poured into ice water (400 mL). The precipitate was collected by filtration and dried under vacuum to give 21 g of the target product 2-methyl-3-nitro-5-bromobenzoic acid in 98% yield. | | References | [1] Patent: US2012/264734, 2012, A1. Location in patent: Page/Page column 100 [2] Patent: WO2012/142513, 2012, A1. Location in patent: Page/Page column 288 [3] Patent: US2014/107122, 2014, A1. Location in patent: Paragraph 0157; 0158 [4] Patent: WO2003/99275, 2003, A1. Location in patent: Page 101 [5] Patent: US2007/219212, 2007, A1. Location in patent: Page/Page column 23 |
| | 5-Bromo-2-methyl-3-nitrobenzoic acid Preparation Products And Raw materials |
|