| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 3-[2-(Diethylamino)ethyl]-7-hydroxy-4-methylcoumarin hydrochloride Basic information |
| | 3-[2-(Diethylamino)ethyl]-7-hydroxy-4-methylcoumarin hydrochloride Chemical Properties |
| Melting point | 284-287 °C (dec.)(lit.) | | form | solid | | InChI | 1S/C16H21NO3.ClH/c1-4-17(5-2)9-8-14-11(3)13-7-6-12(18)10-15(13)20-16(14)19;/h6-7,10,18H,4-5,8-9H2,1-3H3;1H | | InChIKey | RLJNKMCFVQMDFR-UHFFFAOYSA-N | | SMILES | Cl[H].CCN(CC)CCC1=C(C)c2ccc(O)cc2OC1=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-[2-(Diethylamino)ethyl]-7-hydroxy-4-methylcoumarin hydrochloride Usage And Synthesis |
| Uses | 3-[2-(Diethylamino)ethyl]-7-hydroxy-4-methylcoumarin hydrochloride was used in the synthesis of:
- novel metal-free and zinc phthalocyanines with four 3-[(2-diethylamino)ethyl]-7-oxo-4-methylcoumarin dye groups via cyclotetramerization
- 3-(2-diethylaminoethyl)-4-methyl-7-substituted coumarins, having antifungal activities against Botrytis cinerea
|
| | 3-[2-(Diethylamino)ethyl]-7-hydroxy-4-methylcoumarin hydrochloride Preparation Products And Raw materials |
|