| Company Name: |
Cool Pharm, Ltd Gold |
| Tel: |
021-58581007 18019463053 |
| Email: |
sales@coolpharm.com |
4-Dimethylaminobutyric acid hydrochloride manufacturers
|
| | 4-Dimethylaminobutyric acid hydrochloride Basic information |
| | 4-Dimethylaminobutyric acid hydrochloride Chemical Properties |
| Melting point | 153-155 °C(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | Appearance | Off-white to pink Solid | | Sensitive | Hygroscopic | | Major Application | peptide synthesis | | InChI | InChI=1S/C6H13NO2.ClH/c1-7(2)5-3-4-6(8)9;/h3-5H2,1-2H3,(H,8,9);1H | | InChIKey | RDTALXUBMCLWBB-UHFFFAOYSA-N | | SMILES | C(=O)(O)CCCN(C)C.Cl | | CAS DataBase Reference | 69954-66-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Dimethylaminobutyric acid hydrochloride Usage And Synthesis |
| Chemical Properties | white granular crystalline powder | | Uses | 4-Dimethylaminobutyric acid hydrochloride is used as pharmaceutical intermediates. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | 4-Dimethylaminobutyric acid hydrochloride Preparation Products And Raw materials |
|