|
|
| | 2,7-Dibromo-9H-fluoren-9-one Basic information |
| Product Name: | 2,7-Dibromo-9H-fluoren-9-one | | Synonyms: | DibroMo-9-fluoren;2,7-Dibromo-9-fluorenone 96%;2,7-DIBROMO-9H-FLUOREN-9-ONE;2,7-DIBROMO-FLUOREN-9-ONE;2,7-DIBROMOFLUORENONE;2,7-DIBROMOFLUORENONE 99+%;2,7-Dibromo-9-Fluorenone (DBF);2,7-Dibromo-9-fluorenone or 2,7-Dibromofluorenone | | CAS: | 14348-75-5 | | MF: | C13H6Br2O | | MW: | 337.99 | | EINECS: | 604-362-6 | | Product Categories: | OLED materials,pharm chemical,electronic;Fluorene Series;blocks;Bromides;Aromatic Halides (substituted);Fluorene Derivatives;Electronic Chemicals;Fluorenes & Fluorenones;Fluorenones;C13 to C14;Carbonyl Compounds;Ketones;bc0001 | | Mol File: | 14348-75-5.mol |  |
| | 2,7-Dibromo-9H-fluoren-9-one Chemical Properties |
| Melting point | 203-205 °C (lit.) | | Boiling point | 451.4±38.0 °C(Predicted) | | density | 1.907±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Tetrahydrofuran | | form | powder to crystal | | color | Light orange to Yellow to Green | | InChI | InChI=1S/C13H6Br2O/c14-7-1-3-9-10-4-2-8(15)6-12(10)13(16)11(9)5-7/h1-6H | | InChIKey | CWGRCRZFJOXQFV-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=CC(Br)=C2)C2=C1C=C(Br)C=C2 | | CAS DataBase Reference | 14348-75-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29147000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,7-Dibromo-9H-fluoren-9-one Usage And Synthesis |
| Chemical Properties | Yellow powder or crystal | | Uses | 2,7-Dibromo-9-fluorenone was used in preparation of :
- 2,7-poly(spiro[4′,4′-dioctyl-2′,6′-dioxocyclohexane-1′,9-fluorene]), precursor polymer for the synthesis of 2,7-poly(9-fluorenone)
- 2,7-dibromo-9-(2-methylpyridin-5-yl)fluoren-9-ol
| | Synthesis | In a 250 mL four-necked flask equipped with a thermometer, reflux condenser tube and mechanical stirring, 12.4 g (77.75 mmol) of bromine, 85 mL of water, 10 g (55.56 mmol) of fluorenone was added with stirring, heated, and the reaction was carried out at 95-100 C for 3 h. The reaction was stopped, and the reaction was cooled to room temperature; the pH of the reaction system was adjusted to neutrality, 9.3 g ( 58.31 mmol) bromine, heated to 95-100 under stirring for 4 hours, stop the reaction, cooled to room temperature; adjust the pH of the reaction system to neutral, add 6.3g (38.87 mmol) bromine, heated to 95-100 under stirring for 4 hours, stop the reaction; cooled, filtration, the resulting solids were washed three times with 30 mL of water, and drying to obtain yellow color. Solid product, yield 98%. |
| | 2,7-Dibromo-9H-fluoren-9-one Preparation Products And Raw materials |
|