| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- TIN(IV) TERT-BUTOXIDE
-
- $8.66
-
2020-03-16
- CAS:36809-75-3
- Min. Order: 1KG
- Purity: 95.0%-99.0%
- Supply Ability: 1kg-100kg
|
| | Tin(IV) tert-butoxide Basic information |
| | Tin(IV) tert-butoxide Chemical Properties |
| Melting point | 40-44 °C(lit.) | | Boiling point | 65°C 0,3mm | | density | 1,06 g/cm3 | | Fp | 65°C/0.3mm | | form | liquid | | color | white solid to turbid colorless | | Sensitive | Moisture Sensitive | | Stability: | Stable. Incompatible with oxidizing agents. | | InChI | 1S/4C4H9O.Sn/c4*1-4(2,3)5;/h4*1-3H3;/q4*-1;+4 | | InChIKey | OSXGKVOYAKRLCS-UHFFFAOYSA-N | | SMILES | CC(C)(C)O[Sn](OC(C)(C)C)(OC(C)(C)C)OC(C)(C)C |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36/37 | | RIDADR | UN 3146 6.1/PG 3 | | WGK Germany | 3 | | TSCA | No | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2905190098 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 4 Dermal Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Tin(IV) tert-butoxide Usage And Synthesis |
| Chemical Properties | solid | | Uses | - Metal Oxide Electrospun Nanofibrous Membranes for Effective Dye Degradation and Sustainable Photocatalysis: This study involves the use of Tin(IV) tert-butoxide in the preparation of metal oxide nanofibrous membranes for photocatalytic applications, highlighting its relevance in material science and sustainable technology (V Jagadeesh Babu et al., 2023).
- Atmospheric atomic layer deposition of SnO2 thin films with tin (II) acetylacetonate and water: The research uses Tin(IV) tert-butoxide in a process to develop SnO2 thin films, critical for electronics and optoelectronics, showcasing its utility in advanced material synthesis (VH Nguyen et al., 2022).
| | reaction suitability | core: tin |
| | Tin(IV) tert-butoxide Preparation Products And Raw materials |
|