N,N-Diethylacrylamide manufacturers
- NN-Diethylacrylamide
-
- $2.00
-
2026-08-25
- CAS:2675-94-7
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
|
| | N,N-Diethylacrylamide Basic information |
| Product Name: | N,N-Diethylacrylamide | | Synonyms: | 2-Propenamide,N,N-diethyl-(9CI);DEAAm;N,N-Diethylacrylamide contains <200 ppm MEHQ as inhibitor, 99%;N,N-Diethylacrylamide (stabilized with MEHQ);N,N-diethyl-2-acrylamide;N,N-Diethylacrylamide, 98%, stabilized with <200 ppm MEHQ;2-Propenamide,N,N-diethyl-;Acrylamide,N,N-diethyl- | | CAS: | 2675-94-7 | | MF: | C7H13NO | | MW: | 127.18 | | EINECS: | 679-769-5 | | Product Categories: | monomer | | Mol File: | 2675-94-7.mol |  |
| | N,N-Diethylacrylamide Chemical Properties |
| Melting point | 93℃/19mm | | Boiling point | 93-95°C 10mm | | density | 0.924 at 25 °C | | vapor pressure | 0.2-47.329Pa at 11.67-34.92℃ | | refractive index | 1.4676 (589.3 nm 20℃) | | Fp | 88℃ | | storage temp. | 2-8°C | | Water Solubility | Soluble in water | | pka | -0.77±0.70(Predicted) | | form | Liquid | | color | Colorless to Light yellow | | InChI | InChI=1S/C7H13NO/c1-4-7(9)8(5-2)6-3/h4H,1,5-6H2,2-3H3 | | InChIKey | OVHHHVAVHBHXAK-UHFFFAOYSA-N | | SMILES | C(N(CC)CC)(=O)C=C | | LogP | 0.61-0.84 at 23-30℃ and pH7.17-7.28 | | Surface tension | 66-67.6mN/m at 1g/L and 20-20.05℃ |
| Hazard Codes | Xi | | Risk Statements | 20/21/22-36/37/38-51-36-22 | | Safety Statements | 26-36/37/39 | | RIDADR | UN 1993 / PGIII | | WGK Germany | 3 | | RTECS | AS3471000 | | HS Code | 29241990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2 |
| | N,N-Diethylacrylamide Usage And Synthesis |
| Uses | Acrylamide monomer used to make polymers for drug delivery; thermal responsive polymers; and solutions with specifically tuned LCSTs. |
| | N,N-Diethylacrylamide Preparation Products And Raw materials |
|