(+/-)-1-Aminocyclopentane-trans-1,3-dicarboxylic acid manufacturers
- trans-ACPD
-
- $41.00
-
2026-08-30
- CAS:67684-64-4
- Purity: 99.98%
- Supply Ability: 10g
|
| | (+/-)-1-Aminocyclopentane-trans-1,3-dicarboxylic acid Basic information |
| Product Name: | (+/-)-1-Aminocyclopentane-trans-1,3-dicarboxylic acid | | Synonyms: | TRANS-(+/-)-1-AMINO-1,3-CYCLOPENTANEDICARBOXYLIC ACID;(+/-)-TRANS-ACPD;TRANS-(+/-)-ACPD;TRANS-ACPD;TRANS(+-)-ACPD EXCITATORY AMINO ACID;trans-(±)-1-Amino-1,3-cyclopentanedicarboxylic acid monohydrate;trans-(±)-ACPD monohydrate;(+/-)-1-Aminocyclopentanl-trans-1,3-Dicarboxylic acid | | CAS: | 67684-64-4 | | MF: | C7H11NO4 | | MW: | 173.17 | | EINECS: | | | Product Categories: | | | Mol File: | 67684-64-4.mol |  |
| | (+/-)-1-Aminocyclopentane-trans-1,3-dicarboxylic acid Chemical Properties |
| Boiling point | 352.7±42.0 °C(Predicted) | | density | 1.452±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | H2O: soluble1mg/mL | | form | solid | | pka | 2.11±0.40(Predicted) | | color | white | | Water Solubility | Soluble to 5 mM in water with gentle warming and to 50 mM in 1eq. NaOH | | InChI | 1S/C7H11NO4.H2O/c8-7(6(11)12)2-1-4(3-7)5(9)10;/h4H,1-3,8H2,(H,9,10)(H,11,12);1H2/t4-,7+;/m1./s1 | | InChIKey | AZRMVYVZWAKHMR-RERZVJIGSA-N | | SMILES | O.N[C@]1(CC[C@H](C1)C(O)=O)C(O)=O |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
| | (+/-)-1-Aminocyclopentane-trans-1,3-dicarboxylic acid Usage And Synthesis |
| Uses | rans-ACPD is a mGluR2 agonist. | | Biological Activity | Equimolecular mixture of (1S,3R)- and (1R,3S)-ACPD. Selective agonist for metabotropic glutamate receptors; active at both group I and group II mGlu receptors (EC 50 values are 2, 15, 23 and ~800 μ M at mGluR 2 , mGluR 1 , mGluR 5 and mGluR 4 respectively). | | storage | Store at RT |
| | (+/-)-1-Aminocyclopentane-trans-1,3-dicarboxylic acid Preparation Products And Raw materials |
|