|
|
| | 3-Aminocyclopentanecarboxylic acid Basic information |
| | 3-Aminocyclopentanecarboxylic acid Chemical Properties |
| Melting point | 240-241 °C (decomp) | | Boiling point | 264.7±33.0 °C(Predicted) | | density | 1.190±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 4.44±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H11NO2/c7-5-2-1-4(3-5)6(8)9/h4-5H,1-3,7H2,(H,8,9) | | InChIKey | MLLSSTJTARJLHK-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)CCC(N)C1 |
| | 3-Aminocyclopentanecarboxylic acid Usage And Synthesis |
| | 3-Aminocyclopentanecarboxylic acid Preparation Products And Raw materials |
|