| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
|
| | p-Iodoclonidine hydrochloride Basic information |
| Product Name: | p-Iodoclonidine hydrochloride | | Synonyms: | 2-[(2,6-DICHLORO-4-IODOPHENYL)IMINO]IMIDAZOLINE HYDROCHLORIDE;P-IODOCLONIDINE HYDROCHLORIDE HIGH AFFIN;p-iodoclonidineHCl;4-iodoclonidine;1H-Imidazol-2-amine, N-(2,6-dichloro-4-iodophenyl)-4,5-dihydro-;p-Iodoclonidine hydrochloride;p-Iodoclonidine hydrochloride | | CAS: | 108294-53-7 | | MF: | C9H8Cl2IN3 | | MW: | 355.99 | | EINECS: | | | Product Categories: | | | Mol File: | 108294-53-7.mol |  |
| | p-Iodoclonidine hydrochloride Chemical Properties |
| solubility | H2O: soluble | | form | solid | | color | white or off-white | | Water Solubility | H2O: soluble | | Major Application | forensics and toxicology
pharmaceutical (small molecule)
veterinary | | InChI | 1S/C9H8Cl2IN3.ClH/c10-6-3-5(12)4-7(11)8(6)15-9-13-1-2-14-9;/h3-4H,1-2H2,(H2,13,14,15);1H | | InChIKey | ULCGXOSKNHMYAX-UHFFFAOYSA-N | | SMILES | Cl[H].Clc1cc(I)cc(Cl)c1\N=C2/NCCN2 |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36/37/39-45 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral |
| | p-Iodoclonidine hydrochloride Usage And Synthesis |
| Uses | p-Iodoclonidine Hydrochloride is a α2-Adrenergic agonist; and displays a high affinity for the α2-adrenergic receptor. | | Biological Activity | High affinity α2 adrenergic receptor agonist. |
| | p-Iodoclonidine hydrochloride Preparation Products And Raw materials |
|