| Company Name: |
Shanghai Anzon Technology CO.,LTD
|
| Tel: |
13918481594 13918481594 |
| Email: |
235259146@qq.com |
| Products Intro: |
Product Name:10-Chlorobenzo[b]phenanthro[2,3-d]furan CAS:3064260-10-9 Purity:99.0% Package:100g;500g;1kg;25kg
|
| Company Name: |
Zhengzhou Converging Chemical Co. LTD
|
| Tel: |
0371-53399770 18037166334 |
| Email: |
3857571523@qq.com |
| Products Intro: |
Product Name:10-chlorobenzo[b]phenanthro[2,3-d]furan CAS:3064260-10-9 Purity:98% Package:1g;5g;10g
|
| Company Name: |
Aikon International Limited
|
| Tel: |
025-58859352 18651614124 |
| Email: |
2881516338@qq.com |
| Products Intro: |
Product Name:10-Chlorobenzo[b]phenanthro[2,3-d]furan CAS:3064260-10-9 Purity:95%+ Package:1g;5g;10g
|
|
| | 10-Chlorobenzo[b]phenanthro[2,3-d]furan Basic information |
| | 10-Chlorobenzo[b]phenanthro[2,3-d]furan Chemical Properties |
| Boiling point | 513.717±23.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.372±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | InChI | InChI=1S/C20H11ClO/c21-14-7-8-16-18-9-13-6-5-12-3-1-2-4-15(12)17(13)11-20(18)22-19(16)10-14/h1-11H | | InChIKey | AEQRXOTZJCFOKY-UHFFFAOYSA-N | | SMILES | ClC1=CC=C2C(=C1)OC1=CC3=C4C=CC=CC4=CC=C3C=C12 |
| | 10-Chlorobenzo[b]phenanthro[2,3-d]furan Usage And Synthesis |
| | 10-Chlorobenzo[b]phenanthro[2,3-d]furan Preparation Products And Raw materials |
|