| Company Name: |
BOC Sciences Gold |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | -N7-DGTP Basic information |
| Product Name: | -N7-DGTP | | Synonyms: | 7-DEAZA-2'-DEOXY-GUANOSINE-5'-TRIPHOSPHATE LITHIUM SALT;7-DEAZA-2'-DEOXYGUANOSINE-5'-TRIPHOSPHORIC ACID, LITHIUM;7-DEAZA-DGTP, LI;7-DEAZA-DGTP LITHIUM SALT;-N7-DGTP;7-deaza-2'-deoxyguanosine 5'-*triphosphate lithiu;7-DEAZA-2'-DEOXYGUANOSINE 5'-*TRIPHOSPHA TE LITHIUM;2'-deoxy-7-deazaguanosine triphosphate | | CAS: | 101515-08-6 | | MF: | C11H17N4O13P3 | | MW: | 506.19 | | EINECS: | | | Product Categories: | Pharmaceutical;Nucleotide | | Mol File: | 101515-08-6.mol |  |
| | -N7-DGTP Chemical Properties |
| density | 2.48±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | form | solution | | pka | 0.97±0.50(Predicted) | | color | colorless | | biological source | Porcine muscle
rabbit muscle | | InChIKey | CEGUJIMDPFZZHS-JEBNKXSCNA-M | | SMILES | C12NC(=NC(=O)C=1C=CN2[C@H]1C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP([O-])(=O)O)O1)N.[Li+] |&1:10,12,14,r| |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | -N7-DGTP Usage And Synthesis |
| Uses | 7-Deaza-dGTP is a substrate for most DNA polymerases, including Taq DNA polymerase.
7-Deaza-dGTP is used in the dideoxy-chain termination sequencing methods, in place of dGTP to overcome compression problems in gel electrophoresis when sequencing GC-rich stretches of DNA.
Partial substitution of 7-Deaza-dGTP for dGTP in PCRs can improve the product yield when the template is GC-rich (i.e., has extensive secondary structures). | | General Description | 7-Deaza-2′-deoxyguanosine 5′-triphosphate enhances polymerase chain reaction (PCR) product yield. | | Biochem/physiol Actions | This dGTP analog pairs weakly with conventional bases to minimize DNA secondary structures, while being a good substrate for DNA ploymerases. |
| | -N7-DGTP Preparation Products And Raw materials |
|