3-(4-FLUOROPHENYL)BENZALDEHYDE manufacturers
|
| | 3-(4-FLUOROPHENYL)BENZALDEHYDE Basic information |
| Product Name: | 3-(4-FLUOROPHENYL)BENZALDEHYDE | | Synonyms: | 3-(4-FLUOROPHENYL)BENZALDEHYDE;AKOS BAR-0062;TIMTEC-BB SBB010233;4'-Fluorobiphenyl-3-carboxaldehyde;4'-FLUOROBIPHENYL-3-CARBALDEHYDE;4'-FLUORO[1,1'-BIPHENYL]-3-CARBALDEHYDE;4'-FLUORO-[1,1'-BIPHENYL]-3-CARBOXALDEHYDE;4'-Fluoro-[1,1'-biphenyl]-3-carbaldehyde | | CAS: | 164334-74-1 | | MF: | C13H9FO | | MW: | 200.21 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | 164334-74-1.mol |  |
| | 3-(4-FLUOROPHENYL)BENZALDEHYDE Chemical Properties |
| Boiling point | 114-116 °C(Press: 0.7 Torr) | | density | 1.173±0.06 g/cm3(Predicted) | | storage temp. | Store at Room Tem. | | form | solid | | InChI | 1S/C13H9FO/c14-13-6-4-11(5-7-13)12-3-1-2-10(8-12)9-15/h1-9H | | InChIKey | IVYDCJYMOBKHTK-UHFFFAOYSA-N | | SMILES | O=CC1=CC(C2=CC=C(F)C=C2)=CC=C1 | | CAS DataBase Reference | 164334-74-1(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-41-22 | | Safety Statements | 26-36/37/39-39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| Provider | Language |
|
ALFA
| English |
| | 3-(4-FLUOROPHENYL)BENZALDEHYDE Usage And Synthesis |
| | 3-(4-FLUOROPHENYL)BENZALDEHYDE Preparation Products And Raw materials |
|