| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Fluoro-1,1'-biphenyl Basic information |
| | 4-Fluoro-1,1'-biphenyl Chemical Properties |
| Melting point | 75-79 °C (lit.) | | Boiling point | 283-284 °C (lit.) | | density | 1.288 g/mL (lit.) | | refractive index | n20/D 1.5200(lit.) | | Fp | >230 °F | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Light yellow | | Water Solubility | INSOLUBLE | | BRN | 2042410 | | InChI | InChI=1S/C12H9F/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H | | InChIKey | RUYZJEIKQYLEGZ-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)=CC=C(F)C=C1 | | CAS DataBase Reference | 324-74-3(CAS DataBase Reference) | | NIST Chemistry Reference | 1,1'-Biphenyl, 4-fluoro-(324-74-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-24/25 | | WGK Germany | 3 | | RTECS | DV5291200 | | HazardClass | IRRITANT | | HS Code | 29039990 | | Storage Class | 11 - Combustible Solids |
| | 4-Fluoro-1,1'-biphenyl Usage And Synthesis |
| Chemical Properties | White to pink solid | | Uses | 4-Fluorobiphenyl is a fluorinated biphenyl compound. It undergoes biochemical degradation in the presence of various mycorrhizal fungi to afford 4-fluorobiphen-4′-ol and 4-fluorobiphen-3′-ol as major products. | | Synthesis Reference(s) | Tetrahedron, 48, p. 8073, 1992 DOI: 10.1016/S0040-4020(01)80478-6 | | General Description | 4-Fluorobiphenyl is a fluorinated biphenyl compound. It undergoes biochemical degradation in the presence of various mycorrhizal fungi to afford 4-fluorobiphen-4′-ol and 4-fluorobiphen-3′-ol as major products. |
| | 4-Fluoro-1,1'-biphenyl Preparation Products And Raw materials |
|