|
|
| | 9beta,11alpha,15S-trihydroxy-prost-13e-en-1-oic acid Basic information |
| Product Name: | 9beta,11alpha,15S-trihydroxy-prost-13e-en-1-oic acid | | Synonyms: | PROSTAGLANDIN F1BETA;DZUXGQBLFALXCR-JQXWHSLNSA-N;9BETA-PGF1ALPHA;Prost-13-en-1-oic acid, 9,11,15-trihydroxy-, (9β,11α,13E,15S)-;Prostaglandin F1β;Alprostadil (Prostaglandin E1) Impurity 12;Alprostadil (prostaglandin E1) impurity 19;PGF1β | | CAS: | 10164-73-5 | | MF: | C20H36O5 | | MW: | 356.5 | | EINECS: | | | Product Categories: | | | Mol File: | 10164-73-5.mol |  |
| | 9beta,11alpha,15S-trihydroxy-prost-13e-en-1-oic acid Chemical Properties |
| Boiling point | 526.5±50.0 °C(Predicted) | | density | 1.136±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMF: >50 mg/ml; DMSO: >50 mg/ml; Ethanol: >75 mg/ml; PBS pH 7.2: >2 mg/ml | | form | A crystalline solid | | pka | 4.78±0.10(Predicted) | | InChI | 1S/C20H36O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h12-13,15-19,21-23H,2-11,14H2,1H3,(H,24,25)/b13-12+/t15-,16+,17+,18+,19+/m0/s1 | | InChIKey | DZUXGQBLFALXCR-JQXWHSLNSA-N | | SMILES | O[C@H]1[C@H](CCCCCCC(O)=O)[C@@H](/C=C/[C@H](CCCCC)O)[C@H](O)C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 9beta,11alpha,15S-trihydroxy-prost-13e-en-1-oic acid Usage And Synthesis |
| Description | PGF1β is the C-9 epimer of PGF1α. It was shown to enhance respiratory rate in experimental animals when administered intravenously.1 | | Uses | Prostaglandin F1β (PGF1β) is the C-9 epimer of 1α. Prostaglandin F1β increased the respiratory rate of rabbits[1]. | | Definition | ChEBI: PGF1beta is a prostanoid. | | References | 1. Brookes, L.G., and Marshall, R.C. The effects of some prostaglandins on respiration in the rabbit J. Pharm. Pharmacol. 26(Suppl),80P-81P(1974). |
| | 9beta,11alpha,15S-trihydroxy-prost-13e-en-1-oic acid Preparation Products And Raw materials |
|