| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | D(-)-Asparagine monohydrate Basic information |
| | D(-)-Asparagine monohydrate Chemical Properties |
| Melting point | 275 °C (dec.)(lit.) | | alpha | -33 º (c=5, 5N HCl, dry sub) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Aqueous Acid (Sparingly), Water (Slightly, Sonicated) | | form | Crystalline | | color | White to Off-White | | Optical Rotation | Consistent with structure | | Water Solubility | 35 g/L (20 ºC) | | Merck | 14,837 | | BRN | 1723526 | | Stability: | Hygroscopic | | Major Application | peptide synthesis | | InChI | 1S/C4H8N2O3.H2O/c5-2(4(8)9)1-3(6)7;/h2H,1,5H2,(H2,6,7)(H,8,9);1H2/t2-;/m1./s1 | | InChIKey | RBMGJIZCEWRQES-HSHFZTNMSA-N | | SMILES | NC(C[C@@H](N)C(O)=O)=O.[H]O[H] | | CAS DataBase Reference | 5794-24-1(CAS DataBase Reference) |
| | D(-)-Asparagine monohydrate Usage And Synthesis |
| Chemical Properties | white crystalline powder or crystals | | Uses | D-(-)-Asparagine monohydrate is an important raw material and intermediate used in organic synthesis, pharmaceuticals agrochemicals and dyestuff fields. |
| | D(-)-Asparagine monohydrate Preparation Products And Raw materials |
|