|
|
| | L-Lysine-2-15N dihydrochloride Basic information |
| | L-Lysine-2-15N dihydrochloride Chemical Properties |
| Melting point | 200-206 °C (dec.)(lit.) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Aqueous Acid (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]20/D +17°, c = 2 in 6 M HCl | | Stability: | Hygroscopic | | InChI | 1S/C6H14N2O2.2ClH/c7-4-2-1-3-5(8)6(9)10;;/h5H,1-4,7-8H2,(H,9,10);2*1H/t5-;;/m0../s1/i8+1;; | | InChIKey | JBBURJFZIMRPCZ-DZWGMXOFSA-N | | SMILES | NCCCC[C@H]([15NH2])C(O)=O.[H]Cl.[H]Cl | | CAS Number Unlabeled | 657-26-1 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-Lysine-2-15N dihydrochloride Usage And Synthesis |
| Uses | L-Lysine-15N dihydrochloride is a 15N-labeled L-Lysine dihydrochloride[1]. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019 Feb;53(2):211-216. DOI:10.1177/1060028018797110 |
| | L-Lysine-2-15N dihydrochloride Preparation Products And Raw materials |
|