|
|
| | (1R,3S)-3-Aminocyclopentanol Basic information |
| Product Name: | (1R,3S)-3-Aminocyclopentanol | | Synonyms: | (1R,3S)-3-Aminocyclopentanol;Cyclopentanol, 3-aMino-, (1R,3S)-;(1R,3S)-3-Aminocyclopentanol(WX600234);(1R,3S)-3-Amino-cyclohexanol hydrochloride;Bictegravir Related Compound 2;Bikagwe-related compounds 2;(1R,3S)-3-aMinocyclopentan-1-ol hydrochloride | | CAS: | 1110772-05-8 | | MF: | C5H11NO | | MW: | 101.15 | | EINECS: | | | Product Categories: | organic building block | | Mol File: | 1110772-05-8.mol |  |
| | (1R,3S)-3-Aminocyclopentanol Chemical Properties |
| Boiling point | 179℃ | | density | 1.084 | | Fp | 62℃ | | storage temp. | 2-8°C(protect from light) | | solubility | Ethanol: soluble | | form | An oil | | pka | 15.06±0.40(Predicted) | | Appearance | yellow liquid | | InChI | InChI=1S/C5H11NO/c6-4-1-2-5(7)3-4/h4-5,7H,1-3,6H2/t4-,5+/m0/s1 | | InChIKey | YHFYRVZIONNYSM-CRCLSJGQSA-N | | SMILES | [C@@H]1(O)CC[C@H](N)C1 |
| | (1R,3S)-3-Aminocyclopentanol Usage And Synthesis |
| Uses | (1R,3S)-3-Aminocyclopentanol is a Bictegravir (1611493-60-7) intermediate and an antiviral agent. |
| | (1R,3S)-3-Aminocyclopentanol Preparation Products And Raw materials |
| Preparation Products | (1R,3S)-3-AMinocyclopentanol hydrochloride-->(2R,5S,13aR)-8-methoxy-7,9-dioxo-2,3,4,5,7,9,13,13a-octahydro-2,5-methanopyrido[1',2':4,5]pyrazino[2,1-b][1,3]oxazepine-10-carboxylic acid |
|