| Company Name: |
DebyeTec.com Inc. |
| Tel: |
18086626237 18086626237 |
| Email: |
2693528373@qq.com |
|
| | (+)-cis-Limonene 1,2-epoxide Basic information |
| Product Name: | (+)-cis-Limonene 1,2-epoxide | | Synonyms: | (Z)-Limonene oxide;cis-1,2-Limonene epoxide;cis-Limonene oxyde;Limonene, epoxy, cis;(+)-CIS-P-MENTHA-1,8-DIENE 1,2-EPOXIDE;(+)-CIS-LIMONENE 1,2-EPOXIDE 97+%;(+)-cis-p-Mentha-1,8-diene 1,2-epoxide, (1R,4R)-1,2-Epoxy-p-menth-8-ene, (1R,2S,4R)-4-Isopropenyl-1-methyl-1-cyclohexene 1,2-epoxide;(1R)-1,2β-Epoxy-1α-methyl-4α-(1-methylethenyl)cyclohexane | | CAS: | 4680-24-4 | | MF: | C10H16O | | MW: | 152.23 | | EINECS: | | | Product Categories: | EPOXYDE | | Mol File: | 4680-24-4.mol |  |
| | (+)-cis-Limonene 1,2-epoxide Chemical Properties |
| Melting point | >1000 °C | | Boiling point | 113-114 °C(Press: 50 Torr) | | density | 0.931 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.466 | | Fp | 65 °C | | storage temp. | 2-8°C | | form | liquid | | InChI | 1S/C10H16O/c1-7(2)8-4-5-10(3)9(6-8)11-10/h8-9H,1,4-6H2,2-3H3/t8-,9+,10-/m0/s1 | | InChIKey | CCEFMUBVSUDRLG-AEJSXWLSSA-N | | SMILES | O1[C@@]2([C@H]1C[C@H](CC2)C(=C)C)C | | LogP | 3.200 (est) |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | F | 10-21 | | Storage Class | 10 - Combustible liquids |
| | (+)-cis-Limonene 1,2-epoxide Usage And Synthesis |
| Uses | cis-(+)-Limonene oxide can be used as:
- A monomer to prepare poly(limonene)carbonate by Al(III) catalyzed coupling reaction with CO2.
- A reactant to prepare trans-diaxial diol via diastereoselective ring-opening reaction using molybdenum complex catalyst.
- A reactant to synthesize trans-dihydrocarvone via isomerization reaction in the presence of silica-supported tungstophosphoric acid as a catalyst and dialkylcarbonate as a green solvent.
', 'cis-(+)-Limonene oxide is a valuable chiral terpene oxide building block. | | Definition | ChEBI: (4R)-limonene 1beta,2beta-epoxide is a (4R)-limonene 1,2-epoxide. |
| | (+)-cis-Limonene 1,2-epoxide Preparation Products And Raw materials |
|