Bis(pentamethylcyclopentadienyl)iron(II) manufacturers
|
| | Bis(pentamethylcyclopentadienyl)iron(II) Basic information |
| Product Name: | Bis(pentamethylcyclopentadienyl)iron(II) | | Synonyms: | Ferrocene, decamethyl-;BIS(PENTAMETHYLCYCLOPENTADIENYL)IRON;dicyclopentadieny iron;BIS(PENTAMETHYLCYCLOPENTADIENYL)IRON, 97 %;Bis(pentamethylcyclopentadienyl)eisen;Bis(pentamethylcyclopentadienyl)iron,99%;bis(pentamethylcyclopentadienyl)iron(ii);bis(2,3,4,5,5-pentaMethylcyclopenta-1,3-dien-1-yl)iron | | CAS: | 12126-50-0 | | MF: | C20H30Fe10* | | MW: | 326.3 | | EINECS: | | | Product Categories: | metallocene | | Mol File: | 12126-50-0.mol |  |
| | Bis(pentamethylcyclopentadienyl)iron(II) Chemical Properties |
| Melting point | 277 °C (dec.)(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | form | crystal | | color | orange | | Water Solubility | Insoluble in water. | | Sensitive | Air & Moisture Sensitive | | Stability: | Stable. Incompatible with strong oxidizing agents. | | InChI | 1S/2C10H15.Fe/c2*1-6-7(2)9(4)10(5)8(6)3;/h2*1-5H3; | | InChIKey | OZHNSXNGSKKWMC-UHFFFAOYSA-N | | SMILES | [Fe].C[C]1[C](C)[C](C)[C](C)[C]1C.C[C]2[C](C)[C](C)[C](C)[C]2C | | CAS DataBase Reference | 12126-50-0(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids |
| | Bis(pentamethylcyclopentadienyl)iron(II) Usage And Synthesis |
| Chemical Properties | crystalline solid | | Uses | Decamethylferrocene is used as a superior internal reference redox standard to ferrocene in voltammetric and amperometric titrations. It is used as photocathode for the detection of barium fluoride scintillation light. | | Uses | Bis(pentamethylcyclopentadienyl)iron(II)(Me10FeCp2, DecMFc) was used as an electron donor to functionalize high purity graphene with metallic palladium via a redox reaction. | | reaction suitability | core: iron reagent type: catalyst |
| | Bis(pentamethylcyclopentadienyl)iron(II) Preparation Products And Raw materials |
|