| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | Bis(I-propylcyclopentadienyl)manganese Basic information |
| Product Name: | Bis(I-propylcyclopentadienyl)manganese | | Synonyms: | Bis(isopropylcyclopentadienyl)manganese;Bis(i-propylcyclopentadienyl)manganese,min.98%;Bis(i-propylcyclopentadienyl)manganese, min. 98%;Bis(i-propylcyclopentadienyl)manganese, 98+%;1,1′-Bis(1-methylethyl) manganocene;Bis(isopropylcyclopentadienyl)manganese 97%;Bis(isopropyL;manganese(2+),5-propan-2-ylcyclopenta-1,3-diene | | CAS: | 85594-02-1 | | MF: | C16H14Mn | | MW: | 261.23 | | EINECS: | | | Product Categories: | metallocene | | Mol File: | 85594-02-1.mol |  |
| | Bis(I-propylcyclopentadienyl)manganese Chemical Properties |
| density | 1.090 g/cm 3 at 25 °C | | Fp | >110℃ | | form | liquid | | color | dark red | | Sensitive | air sensitive, moisture sensitive | | InChI | 1S/2C8H11.Mn/c2*1-7(2)8-5-3-4-6-8;/h2*3-7H,1-2H3; | | InChIKey | CRDYYRDPRXAYHD-UHFFFAOYSA-N | | SMILES | [Mn].CC(C)[C]1[CH][CH][CH][CH]1.CC(C)[C]2[CH][CH][CH][CH]2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Bis(I-propylcyclopentadienyl)manganese Usage And Synthesis |
| reaction suitability | core: manganese
reagent type: catalyst |
| | Bis(I-propylcyclopentadienyl)manganese Preparation Products And Raw materials |
|