| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- 1-Bromo-2-ethylbutane
-
- $1.00
-
2020-01-10
- CAS:3814-34-4
- Min. Order: 1KG
- Purity: 98% HPLC
- Supply Ability: 10 tons/month
|
| | 1-Bromo-2-ethylbutane Basic information |
| | 1-Bromo-2-ethylbutane Chemical Properties |
| Melting point | -44.22°C (estimate) | | Boiling point | 143-144 °C | | density | 1.179 g/mL at 25 °C(lit.) | | refractive index | 1.451-1.453 | | Fp | 35 °C | | storage temp. | Refrigerator (+4°C) + Flammables area | | form | Liquid | | Specific Gravity | 1.179 | | color | Clear colorless to light yellow | | InChI | InChI=1S/C6H13Br/c1-3-6(4-2)5-7/h6H,3-5H2,1-2H3 | | InChIKey | KKGUMGWNFARLSL-UHFFFAOYSA-N | | SMILES | CCC(CBr)CC | | CAS DataBase Reference | 3814-34-4(CAS DataBase Reference) | | NIST Chemistry Reference | Pentane, 3-(bromomethyl)-(3814-34-4) | | EPA Substance Registry System | Pentane, 3-(bromomethyl)- (3814-34-4) |
| Hazard Codes | Xi,F | | Risk Statements | 36/37/38-10 | | Safety Statements | 37/39-26-16-33-29 | | RIDADR | UN 1993 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29033990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | 1-Bromo-2-ethylbutane Usage And Synthesis |
| Chemical Properties | clear colorless to light yellow liquid | | Uses | 1-Bromo-2-ethylbutane can be involved in the synthesis of biologically active molecules. | | Uses | 1-Bromo-2-ethylbutane was used in the preparation of dialkoxytriarylamine. It was also used as cysteine-modifying reagent. | | Toxics Screening Level | The CAS and NLM on-line literature searches were conducted on May 22, 2008. There
was no toxicity data located on 2-ethylbutyl bromide during the literature search. Due to
a lack of available toxicity data, the ITSL will be set at 0.1 μg/m3 with annual averaging
under R232(1)(i). |
| | 1-Bromo-2-ethylbutane Preparation Products And Raw materials |
|