| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Dicyclopentadiene diepoxide Basic information | | Synthesis |
| Product Name: | Dicyclopentadiene diepoxide | | Synonyms: | Bicyelopentadiene dioxide;BICYCLOPENTADIENE DIEPOXIDE;DICYCLOPENTADIENE DIEPOXIDE;4,10-DIOXAPENTACYCLO[6.3.1.0(2,7).0(3,5).0(9,11)]DODECANE;DICYCLOPENTADIENE DIOXIDE, 97%, MIXTURE;Dicyclopentadienediepoxide,99%;2,4-Methano-2H-indeno1,2-b:5,6-bbisoxirene, octahydro-;OCTAHYDRO24METHANO2HINDENO12B56BBISOXIRENE | | CAS: | 81-21-0 | | MF: | C10H12O2 | | MW: | 164.2 | | EINECS: | 201-334-1 | | Product Categories: | | | Mol File: | 81-21-0.mol |  |
| | Dicyclopentadiene diepoxide Chemical Properties |
| Melting point | 185-189 °C(lit.) | | Boiling point | 120°C 10mm | | density | 1,331 g/cm3 | | refractive index | 1.5460 (estimate) | | Fp | 120°C/10mm subl. | | storage temp. | 2-8°C | | form | Crystals or Crystalline Powder | | color | White to yellow-beige | | Water Solubility | Soluble in water. | | BRN | 112743 | | InChI | InChI=1S/C10H12O2/c1-4-3-2-6-10(11-6)7(3)5(1)9-8(4)12-9/h3-10H,1-2H2 | | InChIKey | BQQUFAMSJAKLNB-UHFFFAOYSA-N | | SMILES | O1C2CC3C(C12)C1CC3C2C1O2 | | CAS DataBase Reference | 81-21-0(CAS DataBase Reference) | | EPA Substance Registry System | 2,4-Methano-2H-indeno[1,2-b:5,6-b']bisoxirene, octahydro- (81-21-0) |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | RTECS | PB9625200 | | TSCA | TSCA listed | | HazardClass | 6.1 | | HS Code | 29109000 | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3
toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Irrit. 2 | | Hazardous Substances Data | 81-21-0(Hazardous Substances Data) | | Toxicity | LD50 orl-rat: 210 mg/kg UCDS** 10/5/61 |
| | Dicyclopentadiene diepoxide Usage And Synthesis |
| Synthesis | 
In a threaded test tube, 1.00 g of fluorapatite (FAp) and 0.079 g (0.021 mmol) of catalyst (CetylPy)3 [PW12O40] were weighed, and then 0.134 g (1.02 mmol) of dicyclopentadiene was added to the mixture, followed by 0.33 mL (3.0 mmol) of a 31% aqueous solution of hydrogen peroxide. After thorough stirring, the mixture was allowed to stand at 25 °C. After 96 hours at 25 °C, extraction was performed with the solvent. The solvent was evaporated to give 0.166 g (99% yield, 99% selectivity) of the corresponding Dicyclopentadiene diepoxide.
| | Chemical Properties | white to yellow-beige crystals or | | Uses | Dicyclopentadiene diepoxide acts as an intermediate for epoxy resins, plasticizers and protective coatings. It finds application as a rubber additive and adhesives, which is used at high temperature. Further, it is used in the preparation of endo-3-hydroxy-exo-9-oxa-exo-tetracyclo[5.3.1.02,6.08,10]undecane using lithium aluminum hydride as a reagent. | | Safety Profile | Poison by ingestion andintravenous routes. Mildly toxic by skin contact. A skinirritant. When heated to decomposition it emits acridsmoke and irritating fumes. |
| | Dicyclopentadiene diepoxide Preparation Products And Raw materials |
|