| Company Name: |
Shanghai SuperLan Chemcial Technique Centre
|
| Tel: |
0-2022843681 15618226720 |
| Email: |
chaolaichem@foxmail.com |
| Products Intro: |
Product Name:2,4-Dimethyl-3-nitroaniline
CAS:31167-04-1
Purity:95 Package:1G,5G,10G,50G,100G,1KG
|
|
| | 2,4-Dimethyl-3-nitroaniline Basic information |
| Product Name: | 2,4-Dimethyl-3-nitroaniline | | Synonyms: | 2,4-Dimethyl-3-nitroaniline;2,4-Dimethyl-3-nitrobenzenamine;3-Nitro-2,4-xylidine;3-nitro-2,4-dimethylaniline;Benzenamine, 2,4-dimethyl-3-nitro-;Piribedil Impurity 31-d8 | | CAS: | 31167-04-1 | | MF: | C8H10N2O2 | | MW: | 166.18 | | EINECS: | | | Product Categories: | | | Mol File: | 31167-04-1.mol |  |
| | 2,4-Dimethyl-3-nitroaniline Chemical Properties |
| Melting point | 78 °C | | Boiling point | 307.6±37.0 °C(Predicted) | | density | 1.220±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 2.82±0.10(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C8H10N2O2/c1-5-3-4-7(9)6(2)8(5)10(11)12/h3-4H,9H2,1-2H3 | | InChIKey | MCRYBELDVGNCFW-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(C)C([N+]([O-])=O)=C1C |
| | 2,4-Dimethyl-3-nitroaniline Usage And Synthesis |
| | 2,4-Dimethyl-3-nitroaniline Preparation Products And Raw materials |
|