|
|
| | 5-Chloro-8-methylquinoline-3-carboxylic acid Basic information |
| | 5-Chloro-8-methylquinoline-3-carboxylic acid Chemical Properties |
| Boiling point | 396.2±37.0 °C(Predicted) | | density | 1.406±0.06 g/cm3(Predicted) | | form | solid | | pka | 2.04±0.30(Predicted) | | InChI | 1S/C11H8ClNO2/c1-6-2-3-9(12)8-4-7(11(14)15)5-13-10(6)8/h2-5H,1H3,(H,14,15) | | InChIKey | CMJTVPDKPRZDHT-UHFFFAOYSA-N | | SMILES | Cc1ccc(Cl)c2cc(cnc12)C(O)=O |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 5-Chloro-8-methylquinoline-3-carboxylic acid Usage And Synthesis |
| | 5-Chloro-8-methylquinoline-3-carboxylic acid Preparation Products And Raw materials |
|