| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 5-Chloro-4-hydroxy-8-methylquinoline-3-carboxylic acid ethyl ester Basic information |
| | 5-Chloro-4-hydroxy-8-methylquinoline-3-carboxylic acid ethyl ester Chemical Properties |
| Boiling point | 384.4±37.0 °C(Predicted) | | density | 1.343±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 2.03±0.50(Predicted) | | InChI | 1S/C13H12ClNO3/c1-3-18-13(17)8-6-15-11-7(2)4-5-9(14)10(11)12(8)16/h4-6H,3H2,1-2H3,(H,15,16) | | InChIKey | WTKGYGUNJMKMLV-UHFFFAOYSA-N | | SMILES | CCOC(=O)c1cnc2c(C)ccc(Cl)c2c1O |
| WGK Germany | 3 | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids |
| | 5-Chloro-4-hydroxy-8-methylquinoline-3-carboxylic acid ethyl ester Usage And Synthesis |
| | 5-Chloro-4-hydroxy-8-methylquinoline-3-carboxylic acid ethyl ester Preparation Products And Raw materials |
|