|
|
| | 2-Amino-6-cyclopropylamino-9H-purine Basic information |
| Product Name: | 2-Amino-6-cyclopropylamino-9H-purine | | Synonyms: | 2-Amino-6-cyclopropylamino-9H-purine;1H-Purine-2,6-diaMine, N6-cyclopropyl-;N6-cyxlopropyl-7H-purine-2,6-diaMine;N6-Cyclopropyl-9H-purine-2,6-diamine;N6-Cyclopropyl-9H-purine-2,6-diaMine Methanolate;Cyclopropyldiaminopurine Abacavir;Abacavir Cyclopropyldiaminopurine Impurity;Abacavir Impurity 10 | | CAS: | 120503-69-7 | | MF: | C8H10N6 | | MW: | 190.21 | | EINECS: | | | Product Categories: | | | Mol File: | 120503-69-7.mol |  |
| | 2-Amino-6-cyclopropylamino-9H-purine Chemical Properties |
| Melting point | 172-174oC | | Boiling point | 355.897±52.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.97 | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 8.525±0.20(predicted) | | color | Off-White to Pale Yellow | | Major Application | pharmaceutical pharmaceutical small molecule | | InChI | 1S/C8H10N6/c9-8-13-6-5(10-3-11-6)7(14-8)12-4-1-2-4/h3-4H,1-2H2,(H4,9,10,11,12,13,14) | | InChIKey | IYWUSKBMXQERLH-UHFFFAOYSA-N | | SMILES | [nH]1c2nc(nc(c2nc1)NC3CC3)N |
| WGK Germany | WGK 3 | | Storage Class | 13 - Non Combustible Solids |
| | 2-Amino-6-cyclopropylamino-9H-purine Usage And Synthesis |
| Uses | N6-Cyclopropyl-9H-purine-2,6-diamine is an impurity of Abacavir Sulfate (A105000), a nucleoside reverse transcriptase inhibitor (1,2,3). | | Uses | 2-Amino-6-cyclopropylamino-9H-purine is used in preparation of Purine derivatives as AMPK activating compounds. |
| | 2-Amino-6-cyclopropylamino-9H-purine Preparation Products And Raw materials |
|