(5-Chloropyrazin-2-yl)methanamine manufacturers
|
| | (5-Chloropyrazin-2-yl)methanamine Basic information |
| Product Name: | (5-Chloropyrazin-2-yl)methanamine | | Synonyms: | (5-Chloropyrazin-2-yl)methanamine;C-(5-CHLORO-PYRAZIN-2-YL)-METHYLAMINE;(5-Chloropyrazin-2-yl)methanamine hydrochloride;2-PyrazineMethanaMine, 5-chloro-;5-Chloropyrazine-2-methanamine;(5-Chloropyrazin-2-yl);(5-Chloropyrazin-2-yl)methanamine ISO 9001：2015 REACH;5-Chloro-2-pyrazinemethanamine | | CAS: | 1060814-53-0 | | MF: | C5H6ClN3 | | MW: | 143.57 | | EINECS: | 605-672-4 | | Product Categories: | Building Blocks;Pyrazine | | Mol File: | 1060814-53-0.mol |  |
| | (5-Chloropyrazin-2-yl)methanamine Chemical Properties |
| Boiling point | 233.8±35.0 °C(Predicted) | | density | 1.331±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 6.35±0.29(Predicted) | | InChI | InChI=1S/C5H6ClN3/c6-5-3-8-4(1-7)2-9-5/h2-3H,1,7H2 | | InChIKey | SYZWYECIPSWFJM-UHFFFAOYSA-N | | SMILES | C1(CN)=NC=C(Cl)N=C1 |
| | (5-Chloropyrazin-2-yl)methanamine Usage And Synthesis |
| Uses | 5-Chloro-2-pyrazinemethanamine is a reagent used for the preparation of alkyl and aryl azides by chemoselective diazotization of primary amines with in situ-generated fluorosulfonyl azide. |
| | (5-Chloropyrazin-2-yl)methanamine Preparation Products And Raw materials |
|