|
|
| | 4'-Formyl-biphenyl-4-carboxylic acid Basic information |
| | 4'-Formyl-biphenyl-4-carboxylic acid Chemical Properties |
| Melting point | 150 °C | | Boiling point | 436.8±38.0 °C(Predicted) | | density | 1.264±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | form | solid | | pka | 4.06±0.10(Predicted) | | color | Grey | | InChI | 1S/C14H10O3/c15-9-10-1-3-11(4-2-10)12-5-7-13(8-6-12)14(16)17/h1-9H,(H,16,17) | | InChIKey | JCEAFZUEUSBESW-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccc(cc1)-c2ccc(C=O)cc2 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4'-Formyl-biphenyl-4-carboxylic acid Usage And Synthesis |
| | 4'-Formyl-biphenyl-4-carboxylic acid Preparation Products And Raw materials |
|