|
|
| | α-Desmethyl Anastrozole Basic information |
| Product Name: | α-Desmethyl Anastrozole | | Synonyms: | 2-[3-(1-Cyanoethyl)-5-(1H,1,2,4-triazole-1-ylMethyl)phenyl]-2-Methylpropionitrile;α1,α1,α3-TriMethyl-5-(1H-1,2,4-triazol-1-ylMethyl)-;Anastrozole α-DesMethyl;Anastrozole EP Impurity A;α-Desmethyl Anastrozole;Anastrozole Impurity 6(EP Impurity A);Anastrozole Impurity 6(Anastrozole EP Impurity A);2-[3-[(1RS)-1-Cyanoethyl]-5-(1H-1,2,4-triazol-1-ylmethyl)phenyl]-2-methylpropanenitrile | | CAS: | 1215780-15-6 | | MF: | C16H17N5 | | MW: | 279.34 | | EINECS: | | | Product Categories: | Aromatics, Heterocycles, Impurities, Pharmaceuticals, Intermediates & Fine Chemicals;Aromatics;Heterocycles;Impurities;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 1215780-15-6.mol |  |
| | α-Desmethyl Anastrozole Chemical Properties |
| Boiling point | 477.5±55.0 °C(Predicted) | | density | 1.11±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform, Methanol (Very Slightly) | | pka | 2.63±0.10(Predicted) | | form | Thick Oil | | color | Colorless to Pale Beige | | InChI | InChI=1S/C16H17N5/c1-12(7-17)14-4-13(8-21-11-19-10-20-21)5-15(6-14)16(2,3)9-18/h4-6,10-12H,8H2,1-3H3 | | InChIKey | LXXANTDQIIXQBZ-UHFFFAOYSA-N | | SMILES | c1c(C[n]2ncnc2)cc(C(C)(C#N)C)cc1C(C#N)C |
| | α-Desmethyl Anastrozole Usage And Synthesis |
| Chemical Properties | Pale Yellow Oil | | Uses | An impurity of Anastrozole (A637425) (impurity B). |
| | α-Desmethyl Anastrozole Preparation Products And Raw materials |
|